|
|
|
|
#
|
|
|
|
|
# (C) Copyright 2000-2010
|
|
|
|
|
# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
|
|
|
|
|
#
|
|
|
|
|
# See file CREDITS for list of people who contributed to this
|
|
|
|
|
# project.
|
|
|
|
|
#
|
|
|
|
|
# This program is free software; you can redistribute it and/or
|
|
|
|
|
# modify it under the terms of the GNU General Public License as
|
|
|
|
|
# published by the Free Software Foundatio; either version 2 of
|
|
|
|
|
# the License, or (at your option) any later version.
|
|
|
|
|
#
|
|
|
|
|
# This program is distributed in the hope that it will be useful,
|
|
|
|
|
# but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
|
|
|
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
|
|
|
|
# GNU General Public License for more details.
|
|
|
|
|
#
|
|
|
|
|
# You should have received a copy of the GNU General Public License
|
|
|
|
|
# along with this program; if not, write to the Free Software
|
|
|
|
|
# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
|
|
|
|
|
# MA 02111-1307 USA
|
|
|
|
|
#
|
|
|
|
|
|
|
|
|
|
VERSION = 2010
|
|
|
|
|
PATCHLEVEL = 03
|
|
|
|
|
SUBLEVEL =
|
|
|
|
|
EXTRAVERSION =
|
|
|
|
|
ifneq "$(SUBLEVEL)" ""
|
|
|
|
|
U_BOOT_VERSION = $(VERSION).$(PATCHLEVEL).$(SUBLEVEL)$(EXTRAVERSION)
|
|
|
|
|
else
|
|
|
|
|
U_BOOT_VERSION = $(VERSION).$(PATCHLEVEL)$(EXTRAVERSION)
|
|
|
|
|
endif
|
|
|
|
|
TIMESTAMP_FILE = $(obj)include/timestamp_autogenerated.h
|
|
|
|
|
VERSION_FILE = $(obj)include/version_autogenerated.h
|
|
|
|
|
|
|
|
|
|
HOSTARCH := $(shell uname -m | \
|
|
|
|
|
sed -e s/i.86/i386/ \
|
|
|
|
|
-e s/sun4u/sparc64/ \
|
|
|
|
|
-e s/arm.*/arm/ \
|
|
|
|
|
-e s/sa110/arm/ \
|
|
|
|
|
-e s/powerpc/ppc/ \
|
|
|
|
|
-e s/ppc64/ppc/ \
|
|
|
|
|
-e s/macppc/ppc/)
|
|
|
|
|
|
|
|
|
|
HOSTOS := $(shell uname -s | tr '[:upper:]' '[:lower:]' | \
|
|
|
|
|
sed -e 's/\(cygwin\).*/cygwin/')
|
|
|
|
|
|
|
|
|
|
# Set shell to bash if possible, otherwise fall back to sh
|
|
|
|
|
SHELL := $(shell if [ -x "$$BASH" ]; then echo $$BASH; \
|
|
|
|
|
else if [ -x /bin/bash ]; then echo /bin/bash; \
|
|
|
|
|
else echo sh; fi; fi)
|
|
|
|
|
|
|
|
|
|
export HOSTARCH HOSTOS SHELL
|
|
|
|
|
|
|
|
|
|
# Deal with colliding definitions from tcsh etc.
|
|
|
|
|
VENDOR=
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
# Allow for silent builds
|
|
|
|
|
ifeq (,$(findstring s,$(MAKEFLAGS)))
|
|
|
|
|
XECHO = echo
|
|
|
|
|
else
|
|
|
|
|
XECHO = :
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
#
|
|
|
|
|
# U-boot build supports producing a object files to the separate external
|
|
|
|
|
# directory. Two use cases are supported:
|
|
|
|
|
#
|
|
|
|
|
# 1) Add O= to the make command line
|
|
|
|
|
# 'make O=/tmp/build all'
|
|
|
|
|
#
|
|
|
|
|
# 2) Set environement variable BUILD_DIR to point to the desired location
|
|
|
|
|
# 'export BUILD_DIR=/tmp/build'
|
|
|
|
|
# 'make'
|
|
|
|
|
#
|
|
|
|
|
# The second approach can also be used with a MAKEALL script
|
|
|
|
|
# 'export BUILD_DIR=/tmp/build'
|
|
|
|
|
# './MAKEALL'
|
|
|
|
|
#
|
|
|
|
|
# Command line 'O=' setting overrides BUILD_DIR environent variable.
|
|
|
|
|
#
|
|
|
|
|
# When none of the above methods is used the local build is performed and
|
|
|
|
|
# the object files are placed in the source directory.
|
|
|
|
|
#
|
|
|
|
|
|
|
|
|
|
ifdef O
|
|
|
|
|
ifeq ("$(origin O)", "command line")
|
|
|
|
|
BUILD_DIR := $(O)
|
|
|
|
|
endif
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
ifneq ($(BUILD_DIR),)
|
|
|
|
|
saved-output := $(BUILD_DIR)
|
|
|
|
|
|
|
|
|
|
# Attempt to create a output directory.
|
|
|
|
|
$(shell [ -d ${BUILD_DIR} ] || mkdir -p ${BUILD_DIR})
|
|
|
|
|
|
|
|
|
|
# Verify if it was successful.
|
|
|
|
|
BUILD_DIR := $(shell cd $(BUILD_DIR) && /bin/pwd)
|
|
|
|
|
$(if $(BUILD_DIR),,$(error output directory "$(saved-output)" does not exist))
|
|
|
|
|
endif # ifneq ($(BUILD_DIR),)
|
|
|
|
|
|
|
|
|
|
OBJTREE := $(if $(BUILD_DIR),$(BUILD_DIR),$(CURDIR))
|
|
|
|
|
SRCTREE := $(CURDIR)
|
|
|
|
|
TOPDIR := $(SRCTREE)
|
|
|
|
|
LNDIR := $(OBJTREE)
|
|
|
|
|
export TOPDIR SRCTREE OBJTREE
|
|
|
|
|
|
|
|
|
|
MKCONFIG := $(SRCTREE)/mkconfig
|
|
|
|
|
export MKCONFIG
|
|
|
|
|
|
|
|
|
|
ifneq ($(OBJTREE),$(SRCTREE))
|
|
|
|
|
REMOTE_BUILD := 1
|
|
|
|
|
export REMOTE_BUILD
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
# $(obj) and (src) are defined in config.mk but here in main Makefile
|
|
|
|
|
# we also need them before config.mk is included which is the case for
|
|
|
|
|
# some targets like unconfig, clean, clobber, distclean, etc.
|
|
|
|
|
ifneq ($(OBJTREE),$(SRCTREE))
|
|
|
|
|
obj := $(OBJTREE)/
|
|
|
|
|
src := $(SRCTREE)/
|
|
|
|
|
else
|
|
|
|
|
obj :=
|
|
|
|
|
src :=
|
|
|
|
|
endif
|
|
|
|
|
export obj src
|
|
|
|
|
|
|
|
|
|
# Make sure CDPATH settings don't interfere
|
|
|
|
|
unexport CDPATH
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
ifeq ($(ARCH),powerpc)
|
|
|
|
|
ARCH = ppc
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
# The "tools" are needed early, so put this first
|
|
|
|
|
# Don't include stuff already done in $(LIBS)
|
|
|
|
|
SUBDIRS = tools \
|
|
|
|
|
examples/standalone \
|
|
|
|
|
examples/api
|
|
|
|
|
|
|
|
|
|
.PHONY : $(SUBDIRS)
|
|
|
|
|
|
|
|
|
|
ifeq ($(obj)include/config.mk,$(wildcard $(obj)include/config.mk))
|
|
|
|
|
|
|
|
|
|
# Include autoconf.mk before config.mk so that the config options are available
|
|
|
|
|
# to all top level build files. We need the dummy all: target to prevent the
|
|
|
|
|
# dependency target in autoconf.mk.dep from being the default.
|
|
|
|
|
all:
|
|
|
|
|
sinclude $(obj)include/autoconf.mk.dep
|
|
|
|
|
sinclude $(obj)include/autoconf.mk
|
|
|
|
|
|
|
|
|
|
# load ARCH, BOARD, and CPU configuration
|
|
|
|
|
include $(obj)include/config.mk
|
|
|
|
|
export ARCH CPU BOARD VENDOR SOC
|
|
|
|
|
|
|
|
|
|
# set default to nothing for native builds
|
|
|
|
|
ifeq ($(HOSTARCH),$(ARCH))
|
|
|
|
|
CROSS_COMPILE ?=
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
# load other configuration
|
|
|
|
|
include $(TOPDIR)/config.mk
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
# U-Boot objects....order is important (i.e. start must be first)
|
|
|
|
|
|
|
|
|
|
OBJS = cpu/$(CPU)/start.o
|
|
|
|
|
ifeq ($(CPU),i386)
|
|
|
|
|
OBJS += cpu/$(CPU)/start16.o
|
|
|
|
|
OBJS += cpu/$(CPU)/resetvec.o
|
|
|
|
|
endif
|
|
|
|
|
ifeq ($(CPU),ppc4xx)
|
|
|
|
|
OBJS += cpu/$(CPU)/resetvec.o
|
|
|
|
|
endif
|
|
|
|
|
ifeq ($(CPU),mpc85xx)
|
|
|
|
|
OBJS += cpu/$(CPU)/resetvec.o
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
OBJS := $(addprefix $(obj),$(OBJS))
|
|
|
|
|
|
|
|
|
|
LIBS = lib_generic/libgeneric.a
|
|
|
|
|
LIBS += lib_generic/lzma/liblzma.a
|
|
|
|
|
LIBS += lib_generic/lzo/liblzo.a
|
|
|
|
|
LIBS += $(shell if [ -f board/$(VENDOR)/common/Makefile ]; then echo \
|
|
|
|
|
"board/$(VENDOR)/common/lib$(VENDOR).a"; fi)
|
|
|
|
|
LIBS += cpu/$(CPU)/lib$(CPU).a
|
|
|
|
|
ifdef SOC
|
|
|
|
|
LIBS += cpu/$(CPU)/$(SOC)/lib$(SOC).a
|
|
|
|
|
endif
|
|
|
|
|
ifeq ($(CPU),ixp)
|
|
|
|
|
LIBS += cpu/ixp/npe/libnpe.a
|
|
|
|
|
endif
|
|
|
|
|
LIBS += lib_$(ARCH)/lib$(ARCH).a
|
|
|
|
|
LIBS += fs/cramfs/libcramfs.a fs/fat/libfat.a fs/fdos/libfdos.a fs/jffs2/libjffs2.a \
|
|
|
|
|
fs/reiserfs/libreiserfs.a fs/ext2/libext2fs.a fs/yaffs2/libyaffs2.a \
|
|
|
|
|
fs/ubifs/libubifs.a
|
|
|
|
|
LIBS += net/libnet.a
|
|
|
|
|
LIBS += disk/libdisk.a
|
|
|
|
|
LIBS += drivers/bios_emulator/libatibiosemu.a
|
|
|
|
|
LIBS += drivers/block/libblock.a
|
|
|
|
|
LIBS += drivers/dma/libdma.a
|
|
|
|
|
LIBS += drivers/fpga/libfpga.a
|
|
|
|
|
LIBS += drivers/gpio/libgpio.a
|
|
|
|
|
LIBS += drivers/hwmon/libhwmon.a
|
|
|
|
|
LIBS += drivers/i2c/libi2c.a
|
|
|
|
|
LIBS += drivers/input/libinput.a
|
|
|
|
|
LIBS += drivers/misc/libmisc.a
|
|
|
|
|
LIBS += drivers/mmc/libmmc.a
|
|
|
|
|
LIBS += drivers/mtd/libmtd.a
|
|
|
|
|
LIBS += drivers/mtd/nand/libnand.a
|
|
|
|
|
LIBS += drivers/mtd/onenand/libonenand.a
|
|
|
|
|
LIBS += drivers/mtd/ubi/libubi.a
|
|
|
|
|
LIBS += drivers/mtd/spi/libspi_flash.a
|
Added M5329AFEE and M5329BFEE Platforms
Added board/freescale/m5329evb, cpu/mcf532x, drivers/net,
drivers/serial, immap_5329.h, m5329.h, mcfrtc.h,
include/configs/M5329EVB.h, lib_m68k/interrupts.c, and
rtc/mcfrtc.c
Modified CREDITS, MAKEFILE, Makefile, README, common/cmd_bdinfo.c,
common/cmd_mii.c, include/asm-m68k/byteorder.h, include/asm-m68k/fec.h,
include/asm-m68k/io.h, include/asm-m68k/mcftimer.h,
include/asm-m68k/mcfuart.h, include/asm-m68k/ptrace.h,
include/asm-m68k/u-boot.h, lib_m68k/Makefile, lib_m68k/board.c,
lib_m68k/time.c, net/eth.c and rtc/Makefile
Signed-off-by: TsiChung Liew <Tsi-Chung.Liew@freescale.com>
18 years ago
|
|
|
LIBS += drivers/net/libnet.a
|
|
|
|
|
LIBS += drivers/net/phy/libphy.a
|
|
|
|
|
LIBS += drivers/pci/libpci.a
|
|
|
|
|
LIBS += drivers/pcmcia/libpcmcia.a
|
|
|
|
|
LIBS += drivers/power/libpower.a
|
|
|
|
|
LIBS += drivers/spi/libspi.a
|
|
|
|
|
ifeq ($(CPU),mpc83xx)
|
|
|
|
|
LIBS += drivers/qe/qe.a
|
|
|
|
|
endif
|
|
|
|
|
ifeq ($(CPU),mpc85xx)
|
|
|
|
|
LIBS += drivers/qe/qe.a
|
|
|
|
|
LIBS += cpu/mpc8xxx/ddr/libddr.a
|
|
|
|
|
LIBS += cpu/mpc8xxx/lib8xxx.a
|
|
|
|
|
endif
|
|
|
|
|
ifeq ($(CPU),mpc86xx)
|
|
|
|
|
LIBS += cpu/mpc8xxx/ddr/libddr.a
|
|
|
|
|
LIBS += cpu/mpc8xxx/lib8xxx.a
|
|
|
|
|
endif
|
|
|
|
|
LIBS += drivers/rtc/librtc.a
|
Added M5329AFEE and M5329BFEE Platforms
Added board/freescale/m5329evb, cpu/mcf532x, drivers/net,
drivers/serial, immap_5329.h, m5329.h, mcfrtc.h,
include/configs/M5329EVB.h, lib_m68k/interrupts.c, and
rtc/mcfrtc.c
Modified CREDITS, MAKEFILE, Makefile, README, common/cmd_bdinfo.c,
common/cmd_mii.c, include/asm-m68k/byteorder.h, include/asm-m68k/fec.h,
include/asm-m68k/io.h, include/asm-m68k/mcftimer.h,
include/asm-m68k/mcfuart.h, include/asm-m68k/ptrace.h,
include/asm-m68k/u-boot.h, lib_m68k/Makefile, lib_m68k/board.c,
lib_m68k/time.c, net/eth.c and rtc/Makefile
Signed-off-by: TsiChung Liew <Tsi-Chung.Liew@freescale.com>
18 years ago
|
|
|
LIBS += drivers/serial/libserial.a
|
|
|
|
|
LIBS += drivers/twserial/libtws.a
|
|
|
|
|
LIBS += drivers/usb/gadget/libusb_gadget.a
|
|
|
|
|
LIBS += drivers/usb/host/libusb_host.a
|
|
|
|
|
LIBS += drivers/usb/musb/libusb_musb.a
|
|
|
|
|
LIBS += drivers/usb/phy/libusb_phy.a
|
|
|
|
|
LIBS += drivers/video/libvideo.a
|
|
|
|
|
LIBS += drivers/watchdog/libwatchdog.a
|
|
|
|
|
LIBS += common/libcommon.a
|
|
|
|
|
LIBS += libfdt/libfdt.a
|
|
|
|
|
LIBS += api/libapi.a
|
|
|
|
|
LIBS += post/libpost.a
|
|
|
|
|
|
|
|
|
|
LIBS := $(addprefix $(obj),$(LIBS))
|
|
|
|
|
.PHONY : $(LIBS) $(TIMESTAMP_FILE) $(VERSION_FILE)
|
|
|
|
|
|
|
|
|
|
LIBBOARD = board/$(BOARDDIR)/lib$(BOARD).a
|
|
|
|
|
LIBBOARD := $(addprefix $(obj),$(LIBBOARD))
|
|
|
|
|
|
|
|
|
|
# Add GCC lib
|
|
|
|
|
ifdef USE_PRIVATE_LIBGCC
|
|
|
|
|
ifeq ("$(USE_PRIVATE_LIBGCC)", "yes")
|
|
|
|
|
PLATFORM_LIBGCC = -L $(OBJTREE)/lib_$(ARCH) -lgcc
|
|
|
|
|
else
|
|
|
|
|
PLATFORM_LIBGCC = -L $(USE_PRIVATE_LIBGCC) -lgcc
|
|
|
|
|
endif
|
|
|
|
|
else
|
|
|
|
|
PLATFORM_LIBGCC = -L $(shell dirname `$(CC) $(CFLAGS) -print-libgcc-file-name`) -lgcc
|
|
|
|
|
endif
|
|
|
|
|
PLATFORM_LIBS += $(PLATFORM_LIBGCC)
|
|
|
|
|
export PLATFORM_LIBS
|
|
|
|
|
|
|
|
|
|
# Special flags for CPP when processing the linker script.
|
|
|
|
|
# Pass the version down so we can handle backwards compatibility
|
|
|
|
|
# on the fly.
|
|
|
|
|
LDPPFLAGS += \
|
|
|
|
|
-include $(TOPDIR)/include/u-boot/u-boot.lds.h \
|
|
|
|
|
$(shell $(LD) --version | \
|
|
|
|
|
sed -ne 's/GNU ld version \([0-9][0-9]*\)\.\([0-9][0-9]*\).*/-DLD_MAJOR=\1 -DLD_MINOR=\2/p')
|
|
|
|
|
|
|
|
|
|
ifeq ($(CONFIG_NAND_U_BOOT),y)
|
|
|
|
|
NAND_SPL = nand_spl
|
|
|
|
|
U_BOOT_NAND = $(obj)u-boot-nand.bin
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
ifeq ($(CONFIG_ONENAND_U_BOOT),y)
|
|
|
|
|
ONENAND_IPL = onenand_ipl
|
|
|
|
|
U_BOOT_ONENAND = $(obj)u-boot-onenand.bin
|
|
|
|
|
ONENAND_BIN ?= $(obj)onenand_ipl/onenand-ipl-2k.bin
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
__OBJS := $(subst $(obj),,$(OBJS))
|
|
|
|
|
__LIBS := $(subst $(obj),,$(LIBS)) $(subst $(obj),,$(LIBBOARD))
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
# Always append ALL so that arch config.mk's can add custom ones
|
|
|
|
|
ALL += $(obj)u-boot.srec $(obj)u-boot.bin $(obj)System.map $(U_BOOT_NAND) $(U_BOOT_ONENAND)
|
|
|
|
|
|
|
|
|
|
all: $(ALL)
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.hex: $(obj)u-boot
|
|
|
|
|
$(OBJCOPY) ${OBJCFLAGS} -O ihex $< $@
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.srec: $(obj)u-boot
|
|
|
|
|
$(OBJCOPY) -O srec $< $@
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.bin: $(obj)u-boot
|
|
|
|
|
$(OBJCOPY) ${OBJCFLAGS} -O binary $< $@
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.ldr: $(obj)u-boot
|
|
|
|
|
$(CREATE_LDR_ENV)
|
|
|
|
|
$(LDR) -T $(CONFIG_BFIN_CPU) -c $@ $< $(LDR_FLAGS)
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.ldr.hex: $(obj)u-boot.ldr
|
|
|
|
|
$(OBJCOPY) ${OBJCFLAGS} -O ihex $< $@ -I binary
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.ldr.srec: $(obj)u-boot.ldr
|
|
|
|
|
$(OBJCOPY) ${OBJCFLAGS} -O srec $< $@ -I binary
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.img: $(obj)u-boot.bin
|
|
|
|
|
./tools/mkimage -A $(ARCH) -T firmware -C none \
|
|
|
|
|
-a $(TEXT_BASE) -e 0 \
|
|
|
|
|
-n $(shell sed -n -e 's/.*U_BOOT_VERSION//p' $(VERSION_FILE) | \
|
|
|
|
|
sed -e 's/"[ ]*$$/ for $(BOARD) board"/') \
|
|
|
|
|
-d $< $@
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.imx: $(obj)u-boot.bin
|
|
|
|
|
$(obj)tools/mkimage -n $(IMX_CONFIG) -T imximage \
|
|
|
|
|
-e $(TEXT_BASE) -d $< $@
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.kwb: $(obj)u-boot.bin
|
|
|
|
|
$(obj)tools/mkimage -n $(KWD_CONFIG) -T kwbimage \
|
|
|
|
|
-a $(TEXT_BASE) -e $(TEXT_BASE) -d $< $@
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.sha1: $(obj)u-boot.bin
|
|
|
|
|
$(obj)tools/ubsha1 $(obj)u-boot.bin
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.dis: $(obj)u-boot
|
|
|
|
|
$(OBJDUMP) -d $< > $@
|
|
|
|
|
|
|
|
|
|
GEN_UBOOT = \
|
|
|
|
|
UNDEF_SYM=`$(OBJDUMP) -x $(LIBBOARD) $(LIBS) | \
|
|
|
|
|
sed -n -e 's/.*\($(SYM_PREFIX)__u_boot_cmd_.*\)/-u\1/p'|sort|uniq`;\
|
|
|
|
|
cd $(LNDIR) && $(LD) $(LDFLAGS) $$UNDEF_SYM $(__OBJS) \
|
|
|
|
|
--start-group $(__LIBS) --end-group $(PLATFORM_LIBS) \
|
|
|
|
|
-Map u-boot.map -o u-boot
|
|
|
|
|
$(obj)u-boot: depend $(SUBDIRS) $(OBJS) $(LIBBOARD) $(LIBS) $(LDSCRIPT) $(obj)u-boot.lds
|
|
|
|
|
$(GEN_UBOOT)
|
|
|
|
|
ifeq ($(CONFIG_KALLSYMS),y)
|
|
|
|
|
smap=`$(call SYSTEM_MAP,u-boot) | \
|
|
|
|
|
awk '$$2 ~ /[tTwW]/ {printf $$1 $$3 "\\\\000"}'` ; \
|
|
|
|
|
$(CC) $(CFLAGS) -DSYSTEM_MAP="\"$${smap}\"" \
|
|
|
|
|
-c common/system_map.c -o $(obj)common/system_map.o
|
|
|
|
|
$(GEN_UBOOT) $(obj)common/system_map.o
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
$(OBJS): depend
|
|
|
|
|
$(MAKE) -C cpu/$(CPU) $(if $(REMOTE_BUILD),$@,$(notdir $@))
|
|
|
|
|
|
|
|
|
|
$(LIBS): depend $(SUBDIRS)
|
|
|
|
|
$(MAKE) -C $(dir $(subst $(obj),,$@))
|
|
|
|
|
|
|
|
|
|
$(LIBBOARD): depend $(LIBS)
|
|
|
|
|
$(MAKE) -C $(dir $(subst $(obj),,$@))
|
|
|
|
|
|
|
|
|
|
$(SUBDIRS): depend
|
|
|
|
|
$(MAKE) -C $@ all
|
|
|
|
|
|
|
|
|
|
$(LDSCRIPT): depend
|
|
|
|
|
$(MAKE) -C $(dir $@) $(notdir $@)
|
|
|
|
|
|
|
|
|
|
$(obj)u-boot.lds: $(LDSCRIPT)
|
|
|
|
|
$(CPP) $(CPPFLAGS) $(LDPPFLAGS) -ansi -D__ASSEMBLY__ -P - <$^ >$@
|
|
|
|
|
|
|
|
|
|
$(NAND_SPL): $(TIMESTAMP_FILE) $(VERSION_FILE) $(obj)include/autoconf.mk
|
|
|
|
|
$(MAKE) -C nand_spl/board/$(BOARDDIR) all
|
|
|
|
|
|
|
|
|
|
$(U_BOOT_NAND): $(NAND_SPL) $(obj)u-boot.bin
|
|
|
|
|
cat $(obj)nand_spl/u-boot-spl-16k.bin $(obj)u-boot.bin > $(obj)u-boot-nand.bin
|
|
|
|
|
|
|
|
|
|
$(ONENAND_IPL): $(TIMESTAMP_FILE) $(VERSION_FILE) $(obj)include/autoconf.mk
|
|
|
|
|
$(MAKE) -C onenand_ipl/board/$(BOARDDIR) all
|
|
|
|
|
|
|
|
|
|
$(U_BOOT_ONENAND): $(ONENAND_IPL) $(obj)u-boot.bin
|
|
|
|
|
cat $(ONENAND_BIN) $(obj)u-boot.bin > $(obj)u-boot-onenand.bin
|
|
|
|
|
|
|
|
|
|
$(VERSION_FILE):
|
|
|
|
|
@( printf '#define U_BOOT_VERSION "U-Boot %s%s"\n' "$(U_BOOT_VERSION)" \
|
|
|
|
|
'$(shell $(TOPDIR)/tools/setlocalversion $(TOPDIR))' ) > $@.tmp
|
|
|
|
|
@cmp -s $@ $@.tmp && rm -f $@.tmp || mv -f $@.tmp $@
|
|
|
|
|
|
|
|
|
|
$(TIMESTAMP_FILE):
|
|
|
|
|
@date +'#define U_BOOT_DATE "%b %d %C%y"' > $@
|
|
|
|
|
@date +'#define U_BOOT_TIME "%T"' >> $@
|
|
|
|
|
|
|
|
|
|
gdbtools:
|
|
|
|
|
$(MAKE) -C tools/gdb all || exit 1
|
|
|
|
|
|
|
|
|
|
updater:
|
|
|
|
|
$(MAKE) -C tools/updater all || exit 1
|
|
|
|
|
|
|
|
|
|
env:
|
|
|
|
|
$(MAKE) -C tools/env all MTD_VERSION=${MTD_VERSION} || exit 1
|
|
|
|
|
|
|
|
|
|
# Explicitly make _depend in subdirs containing multiple targets to prevent
|
|
|
|
|
# parallel sub-makes creating .depend files simultaneously.
|
|
|
|
|
depend dep: $(TIMESTAMP_FILE) $(VERSION_FILE) $(obj)include/autoconf.mk
|
|
|
|
|
for dir in $(SUBDIRS) cpu/$(CPU) $(dir $(LDSCRIPT)) ; do \
|
|
|
|
|
$(MAKE) -C $$dir _depend ; done
|
|
|
|
|
|
|
|
|
|
TAG_SUBDIRS = $(SUBDIRS)
|
|
|
|
|
TAG_SUBDIRS += $(dir $(__LIBS))
|
|
|
|
|
TAG_SUBDIRS += include
|
|
|
|
|
|
|
|
|
|
tags ctags:
|
|
|
|
|
ctags -w -o $(obj)ctags `find $(TAG_SUBDIRS) \
|
|
|
|
|
-name '*.[chS]' -print`
|
|
|
|
|
|
|
|
|
|
etags:
|
|
|
|
|
etags -a -o $(obj)etags `find $(TAG_SUBDIRS) \
|
|
|
|
|
-name '*.[chS]' -print`
|
|
|
|
|
cscope:
|
|
|
|
|
find $(TAG_SUBDIRS) -name '*.[chS]' -print > cscope.files
|
|
|
|
|
cscope -b -q -k
|
|
|
|
|
|
|
|
|
|
SYSTEM_MAP = \
|
|
|
|
|
$(NM) $1 | \
|
|
|
|
|
grep -v '\(compiled\)\|\(\.o$$\)\|\( [aUw] \)\|\(\.\.ng$$\)\|\(LASH[RL]DI\)' | \
|
|
|
|
|
LC_ALL=C sort
|
|
|
|
|
$(obj)System.map: $(obj)u-boot
|
|
|
|
|
@$(call SYSTEM_MAP,$<) > $(obj)System.map
|
|
|
|
|
|
|
|
|
|
#
|
|
|
|
|
# Auto-generate the autoconf.mk file (which is included by all makefiles)
|
|
|
|
|
#
|
|
|
|
|
# This target actually generates 2 files; autoconf.mk and autoconf.mk.dep.
|
|
|
|
|
# the dep file is only include in this top level makefile to determine when
|
|
|
|
|
# to regenerate the autoconf.mk file.
|
|
|
|
|
$(obj)include/autoconf.mk.dep: $(obj)include/config.h include/common.h
|
|
|
|
|
@$(XECHO) Generating $@ ; \
|
|
|
|
|
set -e ; \
|
|
|
|
|
: Generate the dependancies ; \
|
|
|
|
|
$(CC) -x c -DDO_DEPS_ONLY -M $(HOSTCFLAGS) $(CPPFLAGS) \
|
|
|
|
|
-MQ $(obj)include/autoconf.mk include/common.h > $@
|
|
|
|
|
|
|
|
|
|
$(obj)include/autoconf.mk: $(obj)include/config.h
|
|
|
|
|
@$(XECHO) Generating $@ ; \
|
|
|
|
|
set -e ; \
|
|
|
|
|
: Extract the config macros ; \
|
|
|
|
|
$(CPP) $(CFLAGS) -DDO_DEPS_ONLY -dM include/common.h | \
|
|
|
|
|
sed -n -f tools/scripts/define2mk.sed > $@.tmp && \
|
|
|
|
|
mv $@.tmp $@
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
else # !config.mk
|
|
|
|
|
all $(obj)u-boot.hex $(obj)u-boot.srec $(obj)u-boot.bin \
|
|
|
|
|
$(obj)u-boot.img $(obj)u-boot.dis $(obj)u-boot \
|
|
|
|
|
$(filter-out tools,$(SUBDIRS)) $(TIMESTAMP_FILE) $(VERSION_FILE) gdbtools \
|
|
|
|
|
updater env depend dep tags ctags etags cscope $(obj)System.map:
|
|
|
|
|
@echo "System not configured - see README" >&2
|
|
|
|
|
@ exit 1
|
|
|
|
|
|
|
|
|
|
tools:
|
|
|
|
|
$(MAKE) -C tools
|
|
|
|
|
tools-all:
|
|
|
|
|
$(MAKE) -C tools HOST_TOOLS_ALL=y
|
|
|
|
|
endif # config.mk
|
|
|
|
|
|
|
|
|
|
.PHONY : CHANGELOG
|
|
|
|
|
CHANGELOG:
|
|
|
|
|
git log --no-merges U-Boot-1_1_5.. | \
|
|
|
|
|
unexpand -a | sed -e 's/\s\s*$$//' > $@
|
|
|
|
|
|
|
|
|
|
include/license.h: tools/bin2header COPYING
|
|
|
|
|
cat COPYING | gzip -9 -c | ./tools/bin2header license_gzip > include/license.h
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
unconfig:
|
|
|
|
|
@rm -f $(obj)include/config.h $(obj)include/config.mk \
|
|
|
|
|
$(obj)board/*/config.tmp $(obj)board/*/*/config.tmp \
|
|
|
|
|
$(obj)include/autoconf.mk $(obj)include/autoconf.mk.dep
|
|
|
|
|
|
|
|
|
|
%: %_config
|
|
|
|
|
$(MAKE)
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
# PowerPC
|
|
|
|
|
#========================================================================
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC5xx Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
canmb_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a canmb ppc mpc5xxx canmb
|
|
|
|
|
|
|
|
|
|
cmi_mpc5xx_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc5xx cmi
|
|
|
|
|
|
|
|
|
|
PATI_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc5xx pati mpl
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC5xxx Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
aev_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a aev ppc mpc5xxx tqm5200 tqc
|
|
|
|
|
|
|
|
|
|
BC3450_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a BC3450 ppc mpc5xxx bc3450
|
|
|
|
|
|
|
|
|
|
cm5200_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a cm5200 ppc mpc5xxx cm5200
|
|
|
|
|
|
|
|
|
|
cpci5200_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a cpci5200 ppc mpc5xxx cpci5200 esd
|
|
|
|
|
|
|
|
|
|
digsy_mtc_config \
|
|
|
|
|
digsy_mtc_LOWBOOT_config \
|
|
|
|
|
digsy_mtc_RAMBOOT_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/digsy_mtc
|
|
|
|
|
@ >$(obj)include/config.h
|
|
|
|
|
@[ -z "$(findstring LOWBOOT_,$@)" ] || \
|
|
|
|
|
{ echo "TEXT_BASE = 0xFF000000" >$(obj)board/digsy_mtc/config.tmp ; \
|
|
|
|
|
echo "... with LOWBOOT configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring RAMBOOT_,$@)" ] || \
|
|
|
|
|
{ echo "TEXT_BASE = 0x00100000" >$(obj)board/digsy_mtc/config.tmp ; \
|
|
|
|
|
echo "... with RAMBOOT configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a digsy_mtc ppc mpc5xxx digsy_mtc
|
|
|
|
|
|
|
|
|
|
galaxy5200_LOWBOOT_config \
|
|
|
|
|
galaxy5200_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_$(@:_config=) 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a galaxy5200 ppc mpc5xxx galaxy5200
|
|
|
|
|
|
|
|
|
|
hmi1001_config: unconfig
|
|
|
|
|
@$(MKCONFIG) hmi1001 ppc mpc5xxx hmi1001
|
|
|
|
|
|
|
|
|
|
Lite5200_config \
|
|
|
|
|
Lite5200_LOWBOOT_config \
|
|
|
|
|
Lite5200_LOWBOOT08_config \
|
|
|
|
|
icecube_5200_config \
|
|
|
|
|
icecube_5200_LOWBOOT_config \
|
|
|
|
|
icecube_5200_LOWBOOT08_config \
|
|
|
|
|
icecube_5200_DDR_config \
|
|
|
|
|
icecube_5200_DDR_LOWBOOT_config \
|
|
|
|
|
icecube_5200_DDR_LOWBOOT08_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/icecube
|
|
|
|
|
@[ -z "$(findstring LOWBOOT_,$@)" ] || \
|
|
|
|
|
{ if [ "$(findstring DDR,$@)" ] ; \
|
|
|
|
|
then echo "TEXT_BASE = 0xFF800000" >$(obj)board/icecube/config.tmp ; \
|
|
|
|
|
else echo "TEXT_BASE = 0xFF000000" >$(obj)board/icecube/config.tmp ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
$(XECHO) "... with LOWBOOT configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring LOWBOOT08,$@)" ] || \
|
|
|
|
|
{ echo "TEXT_BASE = 0xFF800000" >$(obj)board/icecube/config.tmp ; \
|
|
|
|
|
echo "... with 8 MB flash only" ; \
|
|
|
|
|
$(XECHO) "... with LOWBOOT configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring DDR,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_MPC5200_DDR" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... DDR memory revision" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a IceCube ppc mpc5xxx icecube
|
|
|
|
|
|
|
|
|
|
jupiter_config: unconfig
|
|
|
|
|
@$(MKCONFIG) jupiter ppc mpc5xxx jupiter
|
|
|
|
|
|
|
|
|
|
inka4x0_config: unconfig
|
|
|
|
|
@$(MKCONFIG) inka4x0 ppc mpc5xxx inka4x0
|
|
|
|
|
|
|
|
|
|
ipek01_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a ipek01 ppc mpc5xxx ipek01
|
|
|
|
|
|
|
|
|
|
lite5200b_config \
|
|
|
|
|
lite5200b_PM_config \
|
|
|
|
|
lite5200b_LOWBOOT_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/icecube
|
|
|
|
|
@ echo "#define CONFIG_MPC5200_DDR" >>$(obj)include/config.h
|
|
|
|
|
@ $(XECHO) "... DDR memory revision"
|
|
|
|
|
@ echo "#define CONFIG_LITE5200B" >>$(obj)include/config.h
|
|
|
|
|
@[ -z "$(findstring _PM_,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_LITE5200B_PM" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with power management (low-power mode) support" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring LOWBOOT_,$@)" ] || \
|
|
|
|
|
{ echo "TEXT_BASE = 0xFF000000" >$(obj)board/icecube/config.tmp ; \
|
|
|
|
|
$(XECHO) "... with LOWBOOT configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a IceCube ppc mpc5xxx icecube
|
|
|
|
|
|
|
|
|
|
mcc200_config \
|
|
|
|
|
mcc200_SDRAM_config \
|
|
|
|
|
mcc200_highboot_config \
|
|
|
|
|
mcc200_COM12_config \
|
|
|
|
|
mcc200_COM12_SDRAM_config \
|
|
|
|
|
mcc200_COM12_highboot_config \
|
|
|
|
|
mcc200_COM12_highboot_SDRAM_config \
|
|
|
|
|
mcc200_highboot_SDRAM_config \
|
|
|
|
|
prs200_config \
|
|
|
|
|
prs200_DDR_config \
|
|
|
|
|
prs200_highboot_config \
|
|
|
|
|
prs200_highboot_DDR_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/mcc200
|
|
|
|
|
@[ -n "$(findstring highboot,$@)" ] || \
|
|
|
|
|
{ $(XECHO) "... with lowboot configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring highboot,$@)" ] || \
|
|
|
|
|
{ echo "TEXT_BASE = 0xFFF00000" >$(obj)board/mcc200/config.tmp ; \
|
|
|
|
|
$(XECHO) "... with highboot configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -n "$(findstring _SDRAM,$@)" ] || \
|
|
|
|
|
{ if [ -n "$(findstring mcc200,$@)" ]; \
|
|
|
|
|
then \
|
|
|
|
|
$(XECHO) "... with DDR" ; \
|
|
|
|
|
else \
|
|
|
|
|
if [ -n "$(findstring _DDR,$@)" ];\
|
|
|
|
|
then \
|
|
|
|
|
$(XECHO) "... with DDR" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_MCC200_SDRAM" >>$(obj)include/config.h ;\
|
|
|
|
|
$(XECHO) "... with SDRAM" ; \
|
|
|
|
|
fi; \
|
|
|
|
|
fi; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _SDRAM,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_MCC200_SDRAM" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with SDRAM" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring COM12,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_CONSOLE_COM12" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with console on COM12" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring prs200,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_PRS200" >>$(obj)include/config.h ;\
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -n $@ -a mcc200 ppc mpc5xxx mcc200
|
|
|
|
|
|
|
|
|
|
mecp5200_config: unconfig
|
|
|
|
|
@$(MKCONFIG) mecp5200 ppc mpc5xxx mecp5200 esd
|
|
|
|
|
|
|
|
|
|
motionpro_config: unconfig
|
|
|
|
|
@$(MKCONFIG) motionpro ppc mpc5xxx motionpro
|
|
|
|
|
|
|
|
|
|
mucmc52_config: unconfig
|
|
|
|
|
@$(MKCONFIG) mucmc52 ppc mpc5xxx mucmc52
|
|
|
|
|
|
|
|
|
|
munices_config: unconfig
|
|
|
|
|
@$(MKCONFIG) munices ppc mpc5xxx munices
|
|
|
|
|
|
|
|
|
|
MVBC_P_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/mvbc_p
|
|
|
|
|
@ >$(obj)include/config.h
|
|
|
|
|
@[ -z "$(findstring MVBC_P,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_MVBC_P" >>$(obj)include/config.h; }
|
|
|
|
|
@$(MKCONFIG) -n $@ -a MVBC_P ppc mpc5xxx mvbc_p matrix_vision
|
|
|
|
|
|
|
|
|
|
o2dnt_config: unconfig
|
|
|
|
|
@$(MKCONFIG) o2dnt ppc mpc5xxx o2dnt
|
|
|
|
|
|
|
|
|
|
pcm030_config \
|
|
|
|
|
pcm030_LOWBOOT_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/phytec/pcm030
|
|
|
|
|
@ >$(obj)include/config.h
|
|
|
|
|
@[ -z "$(findstring LOWBOOT_,$@)" ] || \
|
|
|
|
|
{ echo "TEXT_BASE = 0xFF000000" >$(obj)board/phytec/pcm030/config.tmp ; \
|
|
|
|
|
echo "... with LOWBOOT configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a pcm030 ppc mpc5xxx pcm030 phytec
|
|
|
|
|
|
|
|
|
|
pf5200_config: unconfig
|
|
|
|
|
@$(MKCONFIG) pf5200 ppc mpc5xxx pf5200 esd
|
|
|
|
|
|
|
|
|
|
PM520_config \
|
|
|
|
|
PM520_DDR_config \
|
|
|
|
|
PM520_ROMBOOT_config \
|
|
|
|
|
PM520_ROMBOOT_DDR_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring DDR,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_MPC5200_DDR" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... DDR memory revision" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring ROMBOOT,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_BOOT_ROM" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... booting from 8-bit flash" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a PM520 ppc mpc5xxx pm520
|
|
|
|
|
|
|
|
|
|
smmaco4_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a smmaco4 ppc mpc5xxx tqm5200 tqc
|
|
|
|
|
|
|
|
|
|
spieval_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a spieval ppc mpc5xxx tqm5200 tqc
|
|
|
|
|
|
|
|
|
|
TB5200_B_config \
|
|
|
|
|
TB5200_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring _B,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_TQM5200_B" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with MPC5200B processor" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -n $@ -a TB5200 ppc mpc5xxx tqm5200 tqc
|
|
|
|
|
|
|
|
|
|
MINI5200_config \
|
|
|
|
|
EVAL5200_config \
|
|
|
|
|
TOP5200_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@ echo "#define CONFIG_$(@:_config=) 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a TOP5200 ppc mpc5xxx top5200 emk
|
|
|
|
|
|
|
|
|
|
Total5200_config \
|
|
|
|
|
Total5200_lowboot_config \
|
|
|
|
|
Total5200_Rev2_config \
|
|
|
|
|
Total5200_Rev2_lowboot_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/total5200
|
|
|
|
|
@[ -n "$(findstring Rev,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_TOTAL5200_REV 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... revision 1 board" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring Rev2_,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_TOTAL5200_REV 2" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... revision 2 board" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring lowboot_,$@)" ] || \
|
|
|
|
|
{ echo "TEXT_BASE = 0xFE000000" >$(obj)board/total5200/config.tmp ; \
|
|
|
|
|
$(XECHO) "... with lowboot configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a Total5200 ppc mpc5xxx total5200
|
|
|
|
|
|
|
|
|
|
cam5200_config \
|
|
|
|
|
cam5200_niosflash_config \
|
|
|
|
|
fo300_config \
|
|
|
|
|
MiniFAP_config \
|
|
|
|
|
TQM5200S_config \
|
|
|
|
|
TQM5200S_HIGHBOOT_config \
|
|
|
|
|
TQM5200_B_config \
|
|
|
|
|
TQM5200_B_HIGHBOOT_config \
|
|
|
|
|
TQM5200_config \
|
|
|
|
|
TQM5200_STK100_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/tqc/tqm5200
|
|
|
|
|
@[ -z "$(findstring cam5200,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_CAM5200" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_TQM5200S" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_TQM5200_B" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... TQM5200S on Cam5200" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring niosflash,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_CAM5200_NIOSFLASH" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with NIOS flash driver" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring fo300,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_FO300" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... TQM5200 on FO300" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring MiniFAP,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_MINIFAP" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... TQM5200_AC on MiniFAP" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring STK100,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_STK52XX_REV100" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... on a STK52XX.100 base board" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring TQM5200_B,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_TQM5200_B" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring TQM5200S,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_TQM5200S" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_TQM5200_B" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring HIGHBOOT,$@)" ] || \
|
|
|
|
|
{ echo "TEXT_BASE = 0xFFF00000" >$(obj)board/tqm5200/config.tmp ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -n $@ -a TQM5200 ppc mpc5xxx tqm5200 tqc
|
|
|
|
|
|
|
|
|
|
uc101_config: unconfig
|
|
|
|
|
@$(MKCONFIG) uc101 ppc mpc5xxx uc101
|
|
|
|
|
|
|
|
|
|
v38b_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a v38b ppc mpc5xxx v38b
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC512x Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
aria_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a aria ppc mpc512x aria davedenx
|
|
|
|
|
|
|
|
|
|
mecp5123_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a mecp5123 ppc mpc512x mecp5123 esd
|
|
|
|
|
|
|
|
|
|
mpc5121ads_config \
|
|
|
|
|
mpc5121ads_rev2_config \
|
|
|
|
|
: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring rev2,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_ADS5121_REV2 1" > $(obj)include/config.h; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a mpc5121ads ppc mpc512x mpc5121ads freescale
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC8xx Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
Adder_config \
|
|
|
|
|
Adder87x_config \
|
|
|
|
|
AdderII_config \
|
|
|
|
|
: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
$(if $(findstring AdderII,$@), \
|
|
|
|
|
@echo "#define CONFIG_MPC852T" > $(obj)include/config.h)
|
|
|
|
|
@$(MKCONFIG) -a Adder ppc mpc8xx adder
|
|
|
|
|
|
|
|
|
|
AdderUSB_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a AdderUSB ppc mpc8xx adder
|
|
|
|
|
|
|
|
|
|
ADS860_config \
|
|
|
|
|
FADS823_config \
|
|
|
|
|
FADS850SAR_config \
|
|
|
|
|
MPC86xADS_config \
|
|
|
|
|
MPC885ADS_config \
|
|
|
|
|
FADS860T_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx fads
|
|
|
|
|
|
|
|
|
|
AMX860_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx amx860 westel
|
|
|
|
|
|
|
|
|
|
c2mon_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx c2mon
|
|
|
|
|
|
|
|
|
|
CCM_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx CCM siemens
|
|
|
|
|
|
|
|
|
|
cogent_mpc8xx_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx cogent
|
|
|
|
|
|
|
|
|
|
ELPT860_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx elpt860 LEOX
|
|
|
|
|
|
|
|
|
|
EP88x_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx ep88x
|
|
|
|
|
|
|
|
|
|
ESTEEM192E_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx esteem192e
|
|
|
|
|
|
|
|
|
|
ETX094_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx etx094
|
|
|
|
|
|
|
|
|
|
FLAGADM_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx flagadm
|
|
|
|
|
|
|
|
|
|
xtract_GEN860T = $(subst _SC,,$(subst _config,,$1))
|
|
|
|
|
|
|
|
|
|
GEN860T_SC_config \
|
|
|
|
|
GEN860T_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring _SC,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_SC" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "With reduced H/W feature set (SC)..." ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_GEN860T,$@) ppc mpc8xx gen860t
|
|
|
|
|
|
|
|
|
|
GENIETV_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx genietv
|
|
|
|
|
|
|
|
|
|
GTH_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx gth
|
|
|
|
|
|
|
|
|
|
hermes_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx hermes
|
|
|
|
|
|
|
|
|
|
HMI10_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx tqm8xx tqc
|
|
|
|
|
|
|
|
|
|
IAD210_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx IAD210 siemens
|
|
|
|
|
|
|
|
|
|
xtract_ICU862 = $(subst _100MHz,,$(subst _config,,$1))
|
|
|
|
|
|
|
|
|
|
ICU862_100MHz_config \
|
|
|
|
|
ICU862_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring _100MHz,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_100MHz" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 100MHz system clock" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_ICU862,$@) ppc mpc8xx icu862
|
|
|
|
|
|
|
|
|
|
IP860_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx ip860
|
|
|
|
|
|
|
|
|
|
IVML24_256_config \
|
|
|
|
|
IVML24_128_config \
|
|
|
|
|
IVML24_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring IVML24_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_IVML24_16M" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring IVML24_128_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_IVML24_32M" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring IVML24_256_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_IVML24_64M" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a IVML24 ppc mpc8xx ivm
|
|
|
|
|
|
|
|
|
|
IVMS8_256_config \
|
|
|
|
|
IVMS8_128_config \
|
|
|
|
|
IVMS8_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring IVMS8_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_IVMS8_16M" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring IVMS8_128_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_IVMS8_32M" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring IVMS8_256_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_IVMS8_64M" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a IVMS8 ppc mpc8xx ivm
|
|
|
|
|
|
|
|
|
|
kmsupx4_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx km8xx keymile
|
|
|
|
|
|
|
|
|
|
KUP4K_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx kup4k kup
|
|
|
|
|
|
|
|
|
|
KUP4X_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx kup4x kup
|
|
|
|
|
|
|
|
|
|
LANTEC_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx lantec
|
|
|
|
|
|
|
|
|
|
lwmon_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx lwmon
|
|
|
|
|
|
|
|
|
|
MBX_config \
|
|
|
|
|
MBX860T_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx mbx8xx
|
|
|
|
|
|
|
|
|
|
mgsuvd_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx km8xx keymile
|
|
|
|
|
|
|
|
|
|
MHPC_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx mhpc eltec
|
|
|
|
|
|
|
|
|
|
xtract_NETVIA = $(subst _V2,,$(subst _config,,$1))
|
|
|
|
|
|
|
|
|
|
NETVIA_V2_config \
|
|
|
|
|
NETVIA_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring NETVIA_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NETVIA_VERSION 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... Version 1" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring NETVIA_V2_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NETVIA_VERSION 2" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... Version 2" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_NETVIA,$@) ppc mpc8xx netvia
|
|
|
|
|
|
|
|
|
|
xtract_NETPHONE = $(subst _V2,,$(subst _config,,$1))
|
|
|
|
|
|
|
|
|
|
NETPHONE_V2_config \
|
|
|
|
|
NETPHONE_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring NETPHONE_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NETPHONE_VERSION 1" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring NETPHONE_V2_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NETPHONE_VERSION 2" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_NETPHONE,$@) ppc mpc8xx netphone
|
|
|
|
|
|
|
|
|
|
xtract_NETTA = $(subst _SWAPHOOK,,$(subst _6412,,$(subst _ISDN,,$(subst _config,,$1))))
|
|
|
|
|
|
|
|
|
|
NETTA_ISDN_6412_SWAPHOOK_config \
|
|
|
|
|
NETTA_ISDN_SWAPHOOK_config \
|
|
|
|
|
NETTA_6412_SWAPHOOK_config \
|
|
|
|
|
NETTA_SWAPHOOK_config \
|
|
|
|
|
NETTA_ISDN_6412_config \
|
|
|
|
|
NETTA_ISDN_config \
|
|
|
|
|
NETTA_6412_config \
|
|
|
|
|
NETTA_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring ISDN_,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NETTA_ISDN 1" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -n "$(findstring ISDN_,$@)" ] || \
|
|
|
|
|
{ echo "#undef CONFIG_NETTA_ISDN" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring 6412_,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NETTA_6412 1" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -n "$(findstring 6412_,$@)" ] || \
|
|
|
|
|
{ echo "#undef CONFIG_NETTA_6412" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring SWAPHOOK_,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NETTA_SWAPHOOK 1" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -n "$(findstring SWAPHOOK_,$@)" ] || \
|
|
|
|
|
{ echo "#undef CONFIG_NETTA_SWAPHOOK" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_NETTA,$@) ppc mpc8xx netta
|
|
|
|
|
|
|
|
|
|
xtract_NETTA2 = $(subst _V2,,$(subst _config,,$1))
|
|
|
|
|
|
|
|
|
|
NETTA2_V2_config \
|
|
|
|
|
NETTA2_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring NETTA2_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NETTA2_VERSION 1" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring NETTA2_V2_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NETTA2_VERSION 2" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_NETTA2,$@) ppc mpc8xx netta2
|
|
|
|
|
|
|
|
|
|
NC650_Rev1_config \
|
|
|
|
|
NC650_Rev2_config \
|
|
|
|
|
CP850_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring CP850,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_CP850 1" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_IDS852_REV2 1" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring Rev1,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_IDS852_REV1 1" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring Rev2,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_IDS852_REV2 1" >>$(obj)include/config.h ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a NC650 ppc mpc8xx nc650
|
|
|
|
|
|
|
|
|
|
NX823_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx nx823
|
|
|
|
|
|
|
|
|
|
pcu_e_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx pcu_e siemens
|
|
|
|
|
|
|
|
|
|
QS850_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx qs850 snmc
|
|
|
|
|
|
|
|
|
|
QS823_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx qs850 snmc
|
|
|
|
|
|
|
|
|
|
QS860T_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx qs860t snmc
|
|
|
|
|
|
|
|
|
|
quantum_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx quantum
|
|
|
|
|
|
|
|
|
|
R360MPI_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx r360mpi
|
|
|
|
|
|
|
|
|
|
RBC823_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx rbc823
|
|
|
|
|
|
|
|
|
|
RPXClassic_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx RPXClassic
|
|
|
|
|
|
|
|
|
|
RPXlite_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx RPXlite
|
|
|
|
|
|
|
|
|
|
RPXlite_DW_64_config \
|
|
|
|
|
RPXlite_DW_LCD_config \
|
|
|
|
|
RPXlite_DW_64_LCD_config \
|
|
|
|
|
RPXlite_DW_NVRAM_config \
|
|
|
|
|
RPXlite_DW_NVRAM_64_config \
|
|
|
|
|
RPXlite_DW_NVRAM_LCD_config \
|
|
|
|
|
RPXlite_DW_NVRAM_64_LCD_config \
|
|
|
|
|
RPXlite_DW_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring _64,$@)" ] || \
|
|
|
|
|
{ echo "#define RPXlite_64MHz" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 64MHz system clock ..."; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _LCD,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_LCD" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_NEC_NL6448BC20" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with LCD display ..."; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _NVRAM,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_ENV_IS_IN_NVRAM" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with ENV in NVRAM ..."; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a RPXlite_DW ppc mpc8xx RPXlite_dw
|
|
|
|
|
|
|
|
|
|
rmu_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx rmu
|
|
|
|
|
|
|
|
|
|
RRvision_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx RRvision
|
|
|
|
|
|
|
|
|
|
RRvision_LCD_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_LCD" >$(obj)include/config.h
|
|
|
|
|
@echo "#define CONFIG_SHARP_LQ104V7DS01" >>$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a RRvision ppc mpc8xx RRvision
|
|
|
|
|
|
|
|
|
|
SM850_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx tqm8xx tqc
|
|
|
|
|
|
|
|
|
|
spc1920_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx spc1920
|
|
|
|
|
|
|
|
|
|
SPD823TS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx spd8xx
|
|
|
|
|
|
|
|
|
|
stxxtc_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx stxxtc stx
|
|
|
|
|
|
|
|
|
|
svm_sc8xx_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx svm_sc8xx
|
|
|
|
|
|
|
|
|
|
SXNI855T_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx sixnet
|
|
|
|
|
|
|
|
|
|
# EMK MPC8xx based modules
|
|
|
|
|
TOP860_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx top860 emk
|
|
|
|
|
|
|
|
|
|
# Play some tricks for configuration selection
|
|
|
|
|
# Only 855 and 860 boards may come with FEC
|
|
|
|
|
# and only 823 boards may have LCD support
|
|
|
|
|
xtract_8xx = $(subst _LCD,,$(subst _config,,$1))
|
|
|
|
|
|
|
|
|
|
FPS850L_config \
|
|
|
|
|
FPS860L_config \
|
|
|
|
|
NSCU_config \
|
|
|
|
|
TQM823L_config \
|
|
|
|
|
TQM823L_LCD_config \
|
|
|
|
|
TQM850L_config \
|
|
|
|
|
TQM855L_config \
|
|
|
|
|
TQM860L_config \
|
|
|
|
|
TQM862L_config \
|
|
|
|
|
TQM823M_config \
|
|
|
|
|
TQM850M_config \
|
|
|
|
|
TQM855M_config \
|
|
|
|
|
TQM860M_config \
|
|
|
|
|
TQM862M_config \
|
|
|
|
|
TQM866M_config \
|
|
|
|
|
TQM885D_config \
|
|
|
|
|
TK885D_config \
|
|
|
|
|
virtlab2_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring _LCD,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_LCD" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_NEC_NL6448BC20" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with LCD display" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_8xx,$@) ppc mpc8xx tqm8xx tqc
|
|
|
|
|
|
|
|
|
|
TTTech_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_LCD" >$(obj)include/config.h
|
|
|
|
|
@echo "#define CONFIG_SHARP_LQ104V7DS01" >>$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a TQM823L ppc mpc8xx tqm8xx tqc
|
|
|
|
|
|
|
|
|
|
uc100_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx uc100
|
|
|
|
|
|
|
|
|
|
v37_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_LCD" >$(obj)include/config.h
|
|
|
|
|
@echo "#define CONFIG_SHARP_LQ084V1DG21" >>$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8xx v37
|
|
|
|
|
|
|
|
|
|
wtk_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_LCD" >$(obj)include/config.h
|
|
|
|
|
@echo "#define CONFIG_SHARP_LQ065T9DR51U" >>$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a TQM823L ppc mpc8xx tqm8xx tqc
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## PPC4xx Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
xtract_4xx = $(subst _25,,$(subst _33,,$(subst _BA,,$(subst _ME,,$(subst _HI,,$(subst _config,,$1))))))
|
|
|
|
|
|
|
|
|
|
acadia_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx acadia amcc
|
|
|
|
|
|
|
|
|
|
acadia_nand_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/amcc/acadia
|
|
|
|
|
@mkdir -p $(obj)nand_spl/board/amcc/acadia
|
|
|
|
|
@echo "#define CONFIG_NAND_U_BOOT" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a acadia ppc ppc4xx acadia amcc
|
|
|
|
|
@echo "TEXT_BASE = 0x01000000" > $(obj)board/amcc/acadia/config.tmp
|
|
|
|
|
@echo "CONFIG_NAND_U_BOOT = y" >> $(obj)include/config.mk
|
|
|
|
|
|
|
|
|
|
ADCIOP_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx adciop esd
|
|
|
|
|
|
|
|
|
|
alpr_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx alpr prodrive
|
|
|
|
|
|
|
|
|
|
AP1000_config:unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx ap1000 amirix
|
|
|
|
|
|
|
|
|
|
APC405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx apc405 esd
|
|
|
|
|
|
|
|
|
|
AR405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx ar405 esd
|
|
|
|
|
|
|
|
|
|
ASH405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx ash405 esd
|
|
|
|
|
|
|
|
|
|
bamboo_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx bamboo amcc
|
|
|
|
|
|
|
|
|
|
bamboo_nand_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/amcc/bamboo
|
|
|
|
|
@mkdir -p $(obj)nand_spl/board/amcc/bamboo
|
|
|
|
|
@echo "#define CONFIG_NAND_U_BOOT" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a bamboo ppc ppc4xx bamboo amcc
|
|
|
|
|
@echo "TEXT_BASE = 0x01000000" > $(obj)board/amcc/bamboo/config.tmp
|
|
|
|
|
@echo "CONFIG_NAND_U_BOOT = y" >> $(obj)include/config.mk
|
|
|
|
|
|
|
|
|
|
bubinga_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx bubinga amcc
|
|
|
|
|
|
|
|
|
|
CANBT_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx canbt esd
|
|
|
|
|
|
|
|
|
|
# Arches, Canyonlands & Glacier use different U-Boot images
|
|
|
|
|
arches_config \
|
|
|
|
|
canyonlands_config \
|
|
|
|
|
glacier_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_$$(echo $(subst ,,$(@:_config=)) | \
|
|
|
|
|
tr '[:lower:]' '[:upper:]')" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a canyonlands ppc ppc4xx canyonlands amcc
|
|
|
|
|
|
|
|
|
|
canyonlands_nand_config \
|
|
|
|
|
glacier_nand_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/amcc/canyonlands
|
|
|
|
|
@mkdir -p $(obj)nand_spl/board/amcc/canyonlands
|
|
|
|
|
@echo "#define CONFIG_NAND_U_BOOT" > $(obj)include/config.h
|
|
|
|
|
@echo "#define CONFIG_$$(echo $(subst ,,$(@:_nand_config=)) | \
|
|
|
|
|
tr '[:lower:]' '[:upper:]')" >> $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a canyonlands ppc ppc4xx canyonlands amcc
|
|
|
|
|
@echo "TEXT_BASE = 0x01000000" > $(obj)board/amcc/canyonlands/config.tmp
|
|
|
|
|
@echo "CONFIG_NAND_U_BOOT = y" >> $(obj)include/config.mk
|
|
|
|
|
|
|
|
|
|
CATcenter_config \
|
|
|
|
|
CATcenter_25_config \
|
|
|
|
|
CATcenter_33_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@ echo "/* CATcenter uses PPChameleon Model ME */" > $(obj)include/config.h
|
|
|
|
|
@ echo "#define CONFIG_PPCHAMELEON_MODULE_MODEL 1" >> $(obj)include/config.h
|
|
|
|
|
@[ -z "$(findstring _25,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_PPCHAMELEON_CLK_25" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "SysClk = 25MHz" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _33,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_PPCHAMELEON_CLK_33" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "SysClk = 33MHz" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_4xx,$@) ppc ppc4xx PPChameleonEVB dave
|
|
|
|
|
|
|
|
|
|
CMS700_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx cms700 esd
|
|
|
|
|
|
|
|
|
|
CPCI2DP_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx cpci2dp esd
|
|
|
|
|
|
|
|
|
|
CPCI405_config \
|
|
|
|
|
CPCI4052_config \
|
|
|
|
|
CPCI405DT_config \
|
|
|
|
|
CPCI405AB_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)board/esd/cpci405
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx cpci405 esd
|
|
|
|
|
|
|
|
|
|
CPCIISER4_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx cpciiser4 esd
|
|
|
|
|
|
|
|
|
|
CRAYL1_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx L1 cray
|
|
|
|
|
|
|
|
|
|
csb272_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx csb272
|
|
|
|
|
|
|
|
|
|
csb472_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx csb472
|
|
|
|
|
|
|
|
|
|
DASA_SIM_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx dasa_sim esd
|
|
|
|
|
|
|
|
|
|
dlvision_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx dlvision gdsys
|
|
|
|
|
|
|
|
|
|
DP405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx dp405 esd
|
|
|
|
|
|
|
|
|
|
DU405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx du405 esd
|
|
|
|
|
|
|
|
|
|
DU440_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx du440 esd
|
|
|
|
|
|
|
|
|
|
ebony_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx ebony amcc
|
|
|
|
|
|
|
|
|
|
ERIC_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx eric
|
|
|
|
|
|
|
|
|
|
fx12mm_flash_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc405-generic
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/avnet/fx12mm
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc405-generic/u-boot-rom.lds"\
|
|
|
|
|
> $(obj)board/avnet/fx12mm/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0xFFCB0000" \
|
|
|
|
|
>> $(obj)board/avnet/fx12mm/config.tmp
|
|
|
|
|
@$(MKCONFIG) fx12mm ppc ppc4xx fx12mm avnet
|
|
|
|
|
|
|
|
|
|
fx12mm_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc405-generic
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/avnet/fx12mm
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc405-generic/u-boot-ram.lds"\
|
|
|
|
|
> $(obj)board/avnet/fx12mm/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0x03000000" \
|
|
|
|
|
>> $(obj)board/avnet/fx12mm/config.tmp
|
|
|
|
|
@$(MKCONFIG) fx12mm ppc ppc4xx fx12mm avnet
|
|
|
|
|
|
|
|
|
|
G2000_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx g2000
|
|
|
|
|
|
|
|
|
|
gdppc440etx_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx gdppc440etx gdsys
|
|
|
|
|
|
|
|
|
|
hcu4_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)board/netstal/common
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx hcu4 netstal
|
|
|
|
|
|
|
|
|
|
hcu5_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)board/netstal/common
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx hcu5 netstal
|
|
|
|
|
|
|
|
|
|
HH405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx hh405 esd
|
|
|
|
|
|
|
|
|
|
HUB405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx hub405 esd
|
|
|
|
|
|
|
|
|
|
# Compact-Center(codename intip) & DevCon-Center use different U-Boot images
|
|
|
|
|
intip_config \
|
|
|
|
|
devconcenter_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_$$(echo $(subst ,,$(@:_config=)) | \
|
|
|
|
|
tr '[:lower:]' '[:upper:]')" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a intip ppc ppc4xx intip gdsys
|
|
|
|
|
|
|
|
|
|
JSE_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx jse
|
|
|
|
|
|
|
|
|
|
KAREF_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx karef sandburst
|
|
|
|
|
|
|
|
|
|
katmai_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx katmai amcc
|
|
|
|
|
|
|
|
|
|
# Kilauea & Haleakala images are identical (recognized via PVR)
|
|
|
|
|
kilauea_config \
|
|
|
|
|
haleakala_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -n $@ -a kilauea ppc ppc4xx kilauea amcc
|
|
|
|
|
|
|
|
|
|
kilauea_nand_config \
|
|
|
|
|
haleakala_nand_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/amcc/kilauea
|
|
|
|
|
@mkdir -p $(obj)nand_spl/board/amcc/kilauea
|
|
|
|
|
@echo "#define CONFIG_NAND_U_BOOT" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a kilauea ppc ppc4xx kilauea amcc
|
|
|
|
|
@echo "TEXT_BASE = 0x01000000" > $(obj)board/amcc/kilauea/config.tmp
|
|
|
|
|
@echo "CONFIG_NAND_U_BOOT = y" >> $(obj)include/config.mk
|
|
|
|
|
|
|
|
|
|
korat_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx korat
|
|
|
|
|
|
|
|
|
|
luan_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx luan amcc
|
|
|
|
|
|
|
|
|
|
lwmon5_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx lwmon5
|
|
|
|
|
|
|
|
|
|
makalu_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx makalu amcc
|
|
|
|
|
|
|
|
|
|
mcu25_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)board/netstal/common
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx mcu25 netstal
|
|
|
|
|
|
|
|
|
|
METROBOX_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx metrobox sandburst
|
|
|
|
|
|
|
|
|
|
MIP405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx mip405 mpl
|
|
|
|
|
|
|
|
|
|
MIP405T_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_MIP405T" >$(obj)include/config.h
|
|
|
|
|
@$(XECHO) "Enable subset config for MIP405T"
|
|
|
|
|
@$(MKCONFIG) -a MIP405 ppc ppc4xx mip405 mpl
|
|
|
|
|
|
|
|
|
|
ML2_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx ml2
|
|
|
|
|
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
ml507_flash_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc440-generic
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ml507
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc440-generic/u-boot-rom.lds"\
|
|
|
|
|
> $(obj)board/xilinx/ml507/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0xFE360000" \
|
|
|
|
|
>> $(obj)board/xilinx/ml507/config.tmp
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
@$(MKCONFIG) ml507 ppc ppc4xx ml507 xilinx
|
|
|
|
|
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
ml507_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc440-generic
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ml507
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc440-generic/u-boot-ram.lds"\
|
|
|
|
|
> $(obj)board/xilinx/ml507/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0x04000000" \
|
|
|
|
|
>> $(obj)board/xilinx/ml507/config.tmp
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
@$(MKCONFIG) ml507 ppc ppc4xx ml507 xilinx
|
|
|
|
|
|
|
|
|
|
neo_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx neo gdsys
|
|
|
|
|
|
|
|
|
|
ocotea_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx ocotea amcc
|
|
|
|
|
|
|
|
|
|
OCRTC_config \
|
|
|
|
|
ORSG_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx ocrtc esd
|
|
|
|
|
|
|
|
|
|
p3p440_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx p3p440 prodrive
|
|
|
|
|
|
|
|
|
|
PCI405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx pci405 esd
|
|
|
|
|
|
|
|
|
|
pcs440ep_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx pcs440ep
|
|
|
|
|
|
|
|
|
|
PIP405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx pip405 mpl
|
|
|
|
|
|
|
|
|
|
PLU405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx plu405 esd
|
|
|
|
|
|
|
|
|
|
PMC405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx pmc405 esd
|
|
|
|
|
|
|
|
|
|
PMC405DE_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx pmc405de esd
|
|
|
|
|
|
|
|
|
|
PMC440_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx pmc440 esd
|
|
|
|
|
|
|
|
|
|
PPChameleonEVB_config \
|
|
|
|
|
PPChameleonEVB_BA_25_config \
|
|
|
|
|
PPChameleonEVB_ME_25_config \
|
|
|
|
|
PPChameleonEVB_HI_25_config \
|
|
|
|
|
PPChameleonEVB_BA_33_config \
|
|
|
|
|
PPChameleonEVB_ME_33_config \
|
|
|
|
|
PPChameleonEVB_HI_33_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring EVB_BA,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_PPCHAMELEON_MODULE_MODEL 0" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... BASIC model" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring EVB_ME,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_PPCHAMELEON_MODULE_MODEL 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... MEDIUM model" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring EVB_HI,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_PPCHAMELEON_MODULE_MODEL 2" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... HIGH-END model" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _25,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_PPCHAMELEON_CLK_25" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "SysClk = 25MHz" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _33,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_PPCHAMELEON_CLK_33" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "SysClk = 33MHz" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_4xx,$@) ppc ppc4xx PPChameleonEVB dave
|
|
|
|
|
|
|
|
|
|
quad100hd_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx quad100hd
|
|
|
|
|
|
|
|
|
|
redwood_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx redwood amcc
|
|
|
|
|
|
|
|
|
|
sbc405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx sbc405
|
|
|
|
|
|
|
|
|
|
sc3_config:unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx sc3
|
|
|
|
|
|
|
|
|
|
sequoia_config \
|
|
|
|
|
rainier_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_$$(echo $(subst ,,$(@:_config=)) | \
|
|
|
|
|
tr '[:lower:]' '[:upper:]')" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a sequoia ppc ppc4xx sequoia amcc
|
|
|
|
|
|
|
|
|
|
sequoia_nand_config \
|
|
|
|
|
rainier_nand_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/amcc/sequoia
|
|
|
|
|
@mkdir -p $(obj)nand_spl/board/amcc/sequoia
|
|
|
|
|
@echo "#define CONFIG_NAND_U_BOOT" > $(obj)include/config.h
|
|
|
|
|
@echo "#define CONFIG_$$(echo $(subst ,,$(@:_config=)) | \
|
|
|
|
|
tr '[:lower:]' '[:upper:]')" >> $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a sequoia ppc ppc4xx sequoia amcc
|
|
|
|
|
@echo "TEXT_BASE = 0x01000000" > $(obj)board/amcc/sequoia/config.tmp
|
|
|
|
|
@echo "CONFIG_NAND_U_BOOT = y" >> $(obj)include/config.mk
|
|
|
|
|
|
|
|
|
|
sequoia_ramboot_config \
|
|
|
|
|
rainier_ramboot_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/amcc/sequoia
|
|
|
|
|
@echo "#define CONFIG_SYS_RAMBOOT" > $(obj)include/config.h
|
|
|
|
|
@echo "#define CONFIG_$$(echo $(subst ,,$(@:_config=)) | \
|
|
|
|
|
tr '[:lower:]' '[:upper:]')" >> $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a sequoia ppc ppc4xx sequoia amcc
|
|
|
|
|
@echo "TEXT_BASE = 0x01000000" > $(obj)board/amcc/sequoia/config.tmp
|
|
|
|
|
@echo "LDSCRIPT = board/amcc/sequoia/u-boot-ram.lds" >> \
|
|
|
|
|
$(obj)board/amcc/sequoia/config.tmp
|
|
|
|
|
|
|
|
|
|
taihu_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx taihu amcc
|
|
|
|
|
|
|
|
|
|
taishan_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx taishan amcc
|
|
|
|
|
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
v5fx30teval_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc440-generic
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
@mkdir -p $(obj)include $(obj)board/avnet/v5fx30teval
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc440-generic/u-boot-ram.lds"\
|
|
|
|
|
> $(obj)board/avnet/v5fx30teval/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0x03000000" \
|
|
|
|
|
>> $(obj)board/avnet/v5fx30teval/config.tmp
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
@$(MKCONFIG) v5fx30teval ppc ppc4xx v5fx30teval avnet
|
|
|
|
|
|
|
|
|
|
v5fx30teval_flash_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc440-generic
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
@mkdir -p $(obj)include $(obj)board/avnet/v5fx30teval
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc440-generic/u-boot-rom.lds"\
|
|
|
|
|
> $(obj)board/avnet/v5fx30teval/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0xFF1C0000" \
|
|
|
|
|
>> $(obj)board/avnet/v5fx30teval/config.tmp
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
@$(MKCONFIG) v5fx30teval ppc ppc4xx v5fx30teval avnet
|
|
|
|
|
|
|
|
|
|
VOH405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx voh405 esd
|
|
|
|
|
|
|
|
|
|
VOM405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx vom405 esd
|
|
|
|
|
|
|
|
|
|
W7OLMC_config \
|
|
|
|
|
W7OLMG_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx w7o
|
|
|
|
|
|
|
|
|
|
# Walnut & Sycamore images are identical (recognized via PVR)
|
|
|
|
|
walnut_config \
|
|
|
|
|
sycamore_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -n $@ -a walnut ppc ppc4xx walnut amcc
|
|
|
|
|
|
|
|
|
|
WUH405_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx wuh405 esd
|
|
|
|
|
|
|
|
|
|
xilinx-ppc405-generic_flash_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc405-generic
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc405-generic/u-boot-rom.lds"\
|
|
|
|
|
> $(obj)board/xilinx/ppc405-generic/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0xFE360000" \
|
|
|
|
|
>> $(obj)board/xilinx/ppc405-generic/config.tmp
|
|
|
|
|
@$(MKCONFIG) xilinx-ppc405-generic ppc ppc4xx ppc405-generic xilinx
|
|
|
|
|
|
|
|
|
|
xilinx-ppc405-generic_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc405-generic
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc405-generic/u-boot-ram.lds"\
|
|
|
|
|
> $(obj)board/xilinx/ppc405-generic/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0x04000000" \
|
|
|
|
|
>> $(obj)board/xilinx/ppc405-generic/config.tmp
|
|
|
|
|
@$(MKCONFIG) xilinx-ppc405-generic ppc ppc4xx ppc405-generic xilinx
|
|
|
|
|
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
xilinx-ppc440-generic_flash_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc440-generic
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc440-generic/u-boot-rom.lds"\
|
|
|
|
|
> $(obj)board/xilinx/ppc440-generic/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0xFE360000" \
|
|
|
|
|
>> $(obj)board/xilinx/ppc440-generic/config.tmp
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
@$(MKCONFIG) xilinx-ppc440-generic ppc ppc4xx ppc440-generic xilinx
|
|
|
|
|
|
|
|
|
|
xilinx-ppc440-generic_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/xilinx/ppc440-generic
|
|
|
|
|
@echo "LDSCRIPT:=$(SRCTREE)/board/xilinx/ppc440-generic/u-boot-ram.lds"\
|
|
|
|
|
> $(obj)board/xilinx/ppc440-generic/config.tmp
|
|
|
|
|
@echo "TEXT_BASE := 0x04000000" \
|
|
|
|
|
>> $(obj)board/xilinx/ppc440-generic/config.tmp
|
ppc44x: Unification of virtex5 pp440 boards
This patch provides an unificated way of handling xilinx v5 ppc440 boards.
It unificates 3 different things:
1) Source code
A new board called ppc440-generic has been created. This board includes
a generic tlb initialization (Maps the whole memory into virtual) and
defines board_pre_init, checkboard, initdram and get_sys_info weakly,
so, they can be replaced by specific functions.
If a new board needs to redefine any of the previous functions
(specific initialization) it can create a new directory with the
specific initializations needed. (see the example ml507 board).
2) Configuration file
Common configurations are located under configs/xilinx-ppc440.h, this
header file interpretes the xparameters file generated by EDK and
configurates u-boot in correspondence. Example: if there is a Temac,
allows CMD_CONFIG_NET
Specific configuration are located under specific configuration file.
(see the example ml507 board)
3) Makefile
Some work has been done in order to not duplicate work in the Main
Makefile. Please see the attached code.
In order to support new boards they can be implemented in the next way:
a) Simple Generic Board (90% of the time)
Using EDK generates a new xparameters.h file, replace
ppc440-generic/xparameters.h and run make xilinx-ppc440-generic_config
&& make
b) Simple Boards with special u-boot parameters (9 % of the time)
Create a new file under configs for it (use ml507.h as example) and
change your paramaters. Create a new Makefile paragraph and compile
c) Complex boards (1% of the time)
Create a new folder for the board, like the ml507
Finally, it adds support for the Avnet FX30T Evaluation board, following
the new generic structure:
Cheap board by Avnet for evaluating the Virtex5 FX technology.
This patch adds support for:
- UartLite
- 16MB Flash
- 64MB RAM
Prior using U-boot in this board, read carefully the ERRATA by Avnet
to solve some memory initialization issues.
Signed-off-by: Ricardo Ribalda Delgado <ricardo.ribalda@uam.es>
Signed-off-by: Stefan Roese <sr@denx.de>
17 years ago
|
|
|
@$(MKCONFIG) xilinx-ppc440-generic ppc ppc4xx ppc440-generic xilinx
|
|
|
|
|
|
|
|
|
|
XPEDITE1000_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx xpedite1000 xes
|
|
|
|
|
|
|
|
|
|
yosemite_config \
|
|
|
|
|
yellowstone_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_$$(echo $(subst ,,$(@:_config=)) | \
|
|
|
|
|
tr '[:lower:]' '[:upper:]')" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -n $@ -a yosemite ppc ppc4xx yosemite amcc
|
|
|
|
|
|
|
|
|
|
yucca_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx yucca amcc
|
|
|
|
|
|
|
|
|
|
zeus_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc ppc4xx zeus
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC8220 Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
Alaska8220_config \
|
|
|
|
|
Yukon8220_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8220 alaska
|
|
|
|
|
|
|
|
|
|
sorcery_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8220 sorcery
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC824x Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
xtract_82xx = $(subst _BIGFLASH,,$(subst _ROMBOOT,,$(subst _L2,,$(subst _266MHz,,$(subst _300MHz,,$(subst _config,,$1))))))
|
|
|
|
|
|
|
|
|
|
A3000_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x a3000
|
|
|
|
|
|
|
|
|
|
barco_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x barco
|
|
|
|
|
|
|
|
|
|
BMW_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x bmw
|
|
|
|
|
|
|
|
|
|
CPC45_config \
|
|
|
|
|
CPC45_ROMBOOT_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(call xtract_82xx,$@) ppc mpc824x cpc45
|
|
|
|
|
@cd $(obj)include ; \
|
|
|
|
|
if [ "$(findstring _ROMBOOT_,$@)" ] ; then \
|
|
|
|
|
echo "CONFIG_BOOT_ROM = y" >> config.mk ; \
|
|
|
|
|
$(XECHO) "... booting from 8-bit flash" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "CONFIG_BOOT_ROM = n" >> config.mk ; \
|
|
|
|
|
$(XECHO) "... booting from 64-bit flash" ; \
|
|
|
|
|
fi; \
|
|
|
|
|
echo "export CONFIG_BOOT_ROM" >> config.mk;
|
|
|
|
|
|
|
|
|
|
CU824_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x cu824
|
|
|
|
|
|
|
|
|
|
debris_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x debris etin
|
|
|
|
|
|
|
|
|
|
eXalion_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x eXalion
|
|
|
|
|
|
|
|
|
|
HIDDEN_DRAGON_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x hidden_dragon
|
|
|
|
|
|
|
|
|
|
kvme080_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x kvme080 etin
|
|
|
|
|
|
|
|
|
|
# HDLAN is broken ATM. Should be fixed as soon as hardware is available and as
|
|
|
|
|
# time permits.
|
|
|
|
|
#linkstation_HDLAN_config \
|
|
|
|
|
# Remove this line when HDLAN is fixed
|
|
|
|
|
linkstation_HGLAN_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@case $@ in \
|
|
|
|
|
*HGLAN*) echo "#define CONFIG_HGLAN 1" >$(obj)include/config.h; ;; \
|
|
|
|
|
*HDLAN*) echo "#define CONFIG_HLAN 1" >$(obj)include/config.h; ;; \
|
|
|
|
|
esac
|
|
|
|
|
@$(MKCONFIG) -n $@ -a linkstation ppc mpc824x linkstation
|
|
|
|
|
|
|
|
|
|
MOUSSE_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x mousse
|
|
|
|
|
|
|
|
|
|
MUSENKI_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x musenki
|
|
|
|
|
|
|
|
|
|
MVBLUE_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x mvblue
|
|
|
|
|
|
|
|
|
|
OXC_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x oxc
|
|
|
|
|
|
|
|
|
|
PN62_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x pn62
|
|
|
|
|
|
|
|
|
|
Sandpoint8240_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x sandpoint
|
|
|
|
|
|
|
|
|
|
Sandpoint8245_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x sandpoint
|
|
|
|
|
|
|
|
|
|
sbc8240_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x sbc8240
|
|
|
|
|
|
|
|
|
|
utx8245_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc824x utx8245
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC8260 Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
atc_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 atc
|
|
|
|
|
|
|
|
|
|
cogent_mpc8260_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 cogent
|
|
|
|
|
|
|
|
|
|
CPU86_config \
|
|
|
|
|
CPU86_ROMBOOT_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(call xtract_82xx,$@) ppc mpc8260 cpu86
|
|
|
|
|
@cd $(obj)include ; \
|
|
|
|
|
if [ "$(findstring _ROMBOOT_,$@)" ] ; then \
|
|
|
|
|
echo "CONFIG_BOOT_ROM = y" >> config.mk ; \
|
|
|
|
|
$(XECHO) "... booting from 8-bit flash" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "CONFIG_BOOT_ROM = n" >> config.mk ; \
|
|
|
|
|
$(XECHO) "... booting from 64-bit flash" ; \
|
|
|
|
|
fi; \
|
|
|
|
|
echo "export CONFIG_BOOT_ROM" >> config.mk;
|
|
|
|
|
|
|
|
|
|
CPU87_config \
|
|
|
|
|
CPU87_ROMBOOT_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(call xtract_82xx,$@) ppc mpc8260 cpu87
|
|
|
|
|
@cd $(obj)include ; \
|
|
|
|
|
if [ "$(findstring _ROMBOOT_,$@)" ] ; then \
|
|
|
|
|
echo "CONFIG_BOOT_ROM = y" >> config.mk ; \
|
|
|
|
|
$(XECHO) "... booting from 8-bit flash" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "CONFIG_BOOT_ROM = n" >> config.mk ; \
|
|
|
|
|
$(XECHO) "... booting from 64-bit flash" ; \
|
|
|
|
|
fi; \
|
|
|
|
|
echo "export CONFIG_BOOT_ROM" >> config.mk;
|
|
|
|
|
|
|
|
|
|
ep8248_config \
|
|
|
|
|
ep8248E_config : unconfig
|
|
|
|
|
@$(MKCONFIG) ep8248 ppc mpc8260 ep8248
|
|
|
|
|
|
|
|
|
|
ep8260_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 ep8260
|
|
|
|
|
|
|
|
|
|
ep82xxm_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 ep82xxm
|
|
|
|
|
|
|
|
|
|
gw8260_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 gw8260
|
|
|
|
|
|
|
|
|
|
hymod_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 hymod
|
|
|
|
|
|
|
|
|
|
IDS8247_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 ids8247
|
|
|
|
|
|
|
|
|
|
IPHASE4539_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 iphase4539
|
|
|
|
|
|
|
|
|
|
ISPAN_config \
|
|
|
|
|
ISPAN_REVB_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _REVB_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_REV_B" > $(obj)include/config.h ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a ISPAN ppc mpc8260 ispan
|
|
|
|
|
|
|
|
|
|
mgcoge_config : unconfig
|
|
|
|
|
@$(MKCONFIG) mgcoge ppc mpc8260 mgcoge keymile
|
|
|
|
|
|
|
|
|
|
MPC8260ADS_config \
|
|
|
|
|
MPC8260ADS_lowboot_config \
|
|
|
|
|
MPC8260ADS_33MHz_config \
|
|
|
|
|
MPC8260ADS_33MHz_lowboot_config \
|
|
|
|
|
MPC8260ADS_40MHz_config \
|
|
|
|
|
MPC8260ADS_40MHz_lowboot_config \
|
|
|
|
|
MPC8272ADS_config \
|
|
|
|
|
MPC8272ADS_lowboot_config \
|
|
|
|
|
PQ2FADS_config \
|
|
|
|
|
PQ2FADS_lowboot_config \
|
|
|
|
|
PQ2FADS-VR_config \
|
|
|
|
|
PQ2FADS-VR_lowboot_config \
|
|
|
|
|
PQ2FADS-ZU_config \
|
|
|
|
|
PQ2FADS-ZU_lowboot_config \
|
|
|
|
|
PQ2FADS-ZU_66MHz_config \
|
|
|
|
|
PQ2FADS-ZU_66MHz_lowboot_config \
|
|
|
|
|
: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/freescale/mpc8260ads
|
|
|
|
|
$(if $(findstring PQ2FADS,$@), \
|
|
|
|
|
@echo "#define CONFIG_ADSTYPE CONFIG_SYS_PQ2FADS" > $(obj)include/config.h, \
|
|
|
|
|
@echo "#define CONFIG_ADSTYPE CONFIG_SYS_"$(subst MPC,,$(word 1,$(subst _, ,$@))) > $(obj)include/config.h)
|
|
|
|
|
$(if $(findstring MHz,$@), \
|
|
|
|
|
@echo "#define CONFIG_8260_CLKIN" $(subst MHz,,$(word 2,$(subst _, ,$@)))"000000" >> $(obj)include/config.h, \
|
|
|
|
|
$(if $(findstring VR,$@), \
|
|
|
|
|
@echo "#define CONFIG_8260_CLKIN 66000000" >> $(obj)include/config.h))
|
|
|
|
|
@[ -z "$(findstring lowboot_,$@)" ] || \
|
|
|
|
|
{ echo "TEXT_BASE = 0xFF800000" >$(obj)board/freescale/mpc8260ads/config.tmp ; \
|
|
|
|
|
$(XECHO) "... with lowboot configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a MPC8260ADS ppc mpc8260 mpc8260ads freescale
|
|
|
|
|
|
|
|
|
|
MPC8266ADS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 mpc8266ads freescale
|
|
|
|
|
|
|
|
|
|
muas3001_dev_config \
|
|
|
|
|
muas3001_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/muas3001
|
|
|
|
|
@if [ "$(findstring dev,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_MUAS_DEV_BOARD" > $(obj)include/config.h ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a muas3001 ppc mpc8260 muas3001
|
|
|
|
|
|
|
|
|
|
# PM825/PM826 default configuration: small (= 8 MB) Flash / boot from 64-bit flash
|
|
|
|
|
PM825_config \
|
|
|
|
|
PM825_ROMBOOT_config \
|
|
|
|
|
PM825_BIGFLASH_config \
|
|
|
|
|
PM825_ROMBOOT_BIGFLASH_config \
|
|
|
|
|
PM826_config \
|
|
|
|
|
PM826_ROMBOOT_config \
|
|
|
|
|
PM826_BIGFLASH_config \
|
|
|
|
|
PM826_ROMBOOT_BIGFLASH_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/pm826
|
|
|
|
|
@if [ "$(findstring PM825_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_PCI" >$(obj)include/config.h ; \
|
|
|
|
|
else \
|
|
|
|
|
>$(obj)include/config.h ; \
|
|
|
|
|
fi
|
|
|
|
|
@if [ "$(findstring _ROMBOOT_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) "... booting from 8-bit flash" ; \
|
|
|
|
|
echo "#define CONFIG_BOOT_ROM" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0xFF800000" >$(obj)board/pm826/config.tmp ; \
|
|
|
|
|
if [ "$(findstring _BIGFLASH_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) "... with 32 MB Flash" ; \
|
|
|
|
|
echo "#define CONFIG_FLASH_32MB" >>$(obj)include/config.h ; \
|
|
|
|
|
fi; \
|
|
|
|
|
else \
|
|
|
|
|
$(XECHO) "... booting from 64-bit flash" ; \
|
|
|
|
|
if [ "$(findstring _BIGFLASH_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) "... with 32 MB Flash" ; \
|
|
|
|
|
echo "#define CONFIG_FLASH_32MB" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0x40000000" >$(obj)board/pm826/config.tmp ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "TEXT_BASE = 0xFF000000" >$(obj)board/pm826/config.tmp ; \
|
|
|
|
|
fi; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a PM826 ppc mpc8260 pm826
|
|
|
|
|
|
|
|
|
|
PM828_config \
|
|
|
|
|
PM828_PCI_config \
|
|
|
|
|
PM828_ROMBOOT_config \
|
|
|
|
|
PM828_ROMBOOT_PCI_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/pm826
|
|
|
|
|
@if [ "$(findstring _PCI_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_PCI" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with PCI enabled" ; \
|
|
|
|
|
fi
|
|
|
|
|
@if [ "$(findstring _ROMBOOT_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) "... booting from 8-bit flash" ; \
|
|
|
|
|
echo "#define CONFIG_BOOT_ROM" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0xFF800000" >$(obj)board/pm826/config.tmp ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a PM828 ppc mpc8260 pm828
|
|
|
|
|
|
|
|
|
|
ppmc8260_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 ppmc8260
|
|
|
|
|
|
|
|
|
|
Rattler8248_config \
|
|
|
|
|
Rattler_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
$(if $(findstring 8248,$@), \
|
|
|
|
|
@echo "#define CONFIG_MPC8248" > $(obj)include/config.h)
|
|
|
|
|
@$(MKCONFIG) -a Rattler ppc mpc8260 rattler
|
|
|
|
|
|
|
|
|
|
RPXsuper_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 rpxsuper
|
|
|
|
|
|
|
|
|
|
rsdproto_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 rsdproto
|
|
|
|
|
|
|
|
|
|
sacsng_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 sacsng
|
|
|
|
|
|
|
|
|
|
sbc8260_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 sbc8260
|
|
|
|
|
|
|
|
|
|
SCM_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 SCM siemens
|
|
|
|
|
|
|
|
|
|
TQM8255_AA_config \
|
|
|
|
|
TQM8260_AA_config \
|
|
|
|
|
TQM8260_AB_config \
|
|
|
|
|
TQM8260_AC_config \
|
|
|
|
|
TQM8260_AD_config \
|
|
|
|
|
TQM8260_AE_config \
|
|
|
|
|
TQM8260_AF_config \
|
|
|
|
|
TQM8260_AG_config \
|
|
|
|
|
TQM8260_AH_config \
|
|
|
|
|
TQM8260_AI_config \
|
|
|
|
|
TQM8265_AA_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@case "$@" in \
|
|
|
|
|
TQM8255_AA_config) CTYPE=MPC8255; CFREQ=300; CACHE=no; BMODE=8260;; \
|
|
|
|
|
TQM8260_AA_config) CTYPE=MPC8260; CFREQ=200; CACHE=no; BMODE=8260;; \
|
|
|
|
|
TQM8260_AB_config) CTYPE=MPC8260; CFREQ=200; CACHE=yes; BMODE=60x;; \
|
|
|
|
|
TQM8260_AC_config) CTYPE=MPC8260; CFREQ=200; CACHE=yes; BMODE=60x;; \
|
|
|
|
|
TQM8260_AD_config) CTYPE=MPC8260; CFREQ=300; CACHE=no; BMODE=60x;; \
|
|
|
|
|
TQM8260_AE_config) CTYPE=MPC8260; CFREQ=266; CACHE=no; BMODE=8260;; \
|
|
|
|
|
TQM8260_AF_config) CTYPE=MPC8260; CFREQ=300; CACHE=no; BMODE=60x;; \
|
|
|
|
|
TQM8260_AG_config) CTYPE=MPC8260; CFREQ=300; CACHE=no; BMODE=8260;; \
|
|
|
|
|
TQM8260_AH_config) CTYPE=MPC8260; CFREQ=300; CACHE=yes; BMODE=60x;; \
|
|
|
|
|
TQM8260_AI_config) CTYPE=MPC8260; CFREQ=300; CACHE=no; BMODE=60x;; \
|
|
|
|
|
TQM8265_AA_config) CTYPE=MPC8265; CFREQ=300; CACHE=no; BMODE=60x;; \
|
|
|
|
|
esac; \
|
|
|
|
|
if [ "$${CTYPE}" != "MPC8260" ] ; then \
|
|
|
|
|
echo "#define CONFIG_$${CTYPE}" >>$(obj)include/config.h ; \
|
|
|
|
|
fi; \
|
|
|
|
|
echo "#define CONFIG_$${CFREQ}MHz" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "... with $${CFREQ}MHz system clock" ; \
|
|
|
|
|
if [ "$${CACHE}" = "yes" ] ; then \
|
|
|
|
|
echo "#define CONFIG_L2_CACHE" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with L2 Cache support" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#undef CONFIG_L2_CACHE" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... without L2 Cache support" ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${BMODE}" = "60x" ] ; then \
|
|
|
|
|
echo "#define CONFIG_BUSMODE_60x" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 60x Bus Mode" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#undef CONFIG_BUSMODE_60x" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... without 60x Bus Mode" ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a TQM8260 ppc mpc8260 tqm8260 tqc
|
|
|
|
|
|
|
|
|
|
TQM8272_config: unconfig
|
|
|
|
|
@$(MKCONFIG) TQM8272 ppc mpc8260 tqm8272 tqc
|
|
|
|
|
|
|
|
|
|
VoVPN-GW_66MHz_config \
|
|
|
|
|
VoVPN-GW_100MHz_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_CLKIN_$(word 2,$(subst _, ,$@))" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a VoVPN-GW ppc mpc8260 vovpn-gw funkwerk
|
|
|
|
|
|
|
|
|
|
ZPC1900_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc8260 zpc1900
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## Coldfire
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
astro_mcf5373l_config \
|
|
|
|
|
astro_mcf5373l_RAM_config : unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) astro_mcf5373l m68k mcf532x mcf5373l astro
|
|
|
|
|
|
|
|
|
|
M5208EVBE_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 m5208evbe freescale
|
|
|
|
|
|
|
|
|
|
M52277EVB_config \
|
|
|
|
|
M52277EVB_spansion_config \
|
|
|
|
|
M52277EVB_stmicro_config : unconfig
|
|
|
|
|
@case "$@" in \
|
|
|
|
|
M52277EVB_config) FLASH=SPANSION;; \
|
|
|
|
|
M52277EVB_spansion_config) FLASH=SPANSION;; \
|
|
|
|
|
M52277EVB_stmicro_config) FLASH=STMICRO;; \
|
|
|
|
|
esac; \
|
|
|
|
|
if [ "$${FLASH}" = "SPANSION" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_SPANSION_BOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0x00000000" > $(obj)board/freescale/m52277evb/config.tmp ; \
|
|
|
|
|
cp $(obj)board/freescale/m52277evb/u-boot.spa $(obj)board/freescale/m52277evb/u-boot.lds ; \
|
|
|
|
|
$(XECHO) "... with SPANSION boot..." ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${FLASH}" = "STMICRO" ] ; then \
|
|
|
|
|
echo "#define CONFIG_CF_SBF" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_SYS_STMICRO_BOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0x43E00000" > $(obj)board/freescale/m52277evb/config.tmp ; \
|
|
|
|
|
cp $(obj)board/freescale/m52277evb/u-boot.stm $(obj)board/freescale/m52277evb/u-boot.lds ; \
|
|
|
|
|
$(XECHO) "... with ST Micro boot..." ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a M52277EVB m68k mcf5227x m52277evb freescale
|
|
|
|
|
|
|
|
|
|
M5235EVB_config \
|
|
|
|
|
M5235EVB_Flash16_config \
|
|
|
|
|
M5235EVB_Flash32_config: unconfig
|
|
|
|
|
@case "$@" in \
|
|
|
|
|
M5235EVB_config) FLASH=16;; \
|
|
|
|
|
M5235EVB_Flash16_config) FLASH=16;; \
|
|
|
|
|
M5235EVB_Flash32_config) FLASH=32;; \
|
|
|
|
|
esac; \
|
|
|
|
|
if [ "$${FLASH}" != "16" ] ; then \
|
|
|
|
|
echo "#define NORFLASH_PS32BIT 1" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0xFFC00000" > $(obj)board/freescale/m5235evb/config.tmp ; \
|
|
|
|
|
cp $(obj)board/freescale/m5235evb/u-boot.32 $(obj)board/freescale/m5235evb/u-boot.lds ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "TEXT_BASE = 0xFFE00000" > $(obj)board/freescale/m5235evb/config.tmp ; \
|
|
|
|
|
cp $(obj)board/freescale/m5235evb/u-boot.16 $(obj)board/freescale/m5235evb/u-boot.lds ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a M5235EVB m68k mcf523x m5235evb freescale
|
|
|
|
|
|
|
|
|
|
M5249EVB_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 m5249evb freescale
|
|
|
|
|
|
|
|
|
|
M5253DEMO_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 m5253demo freescale
|
|
|
|
|
|
|
|
|
|
M5253EVBE_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 m5253evbe freescale
|
|
|
|
|
|
|
|
|
|
cobra5272_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 cobra5272
|
|
|
|
|
|
|
|
|
|
EB+MCF-EV123_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/BuS/EB+MCF-EV123
|
|
|
|
|
@echo "TEXT_BASE = 0xFFE00000"|tee $(obj)board/BuS/EB+MCF-EV123/textbase.mk
|
|
|
|
|
@$(MKCONFIG) EB+MCF-EV123 m68k mcf52x2 EB+MCF-EV123 BuS
|
|
|
|
|
|
|
|
|
|
EB+MCF-EV123_internal_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/BuS/EB+MCF-EV123
|
|
|
|
|
@echo "TEXT_BASE = 0xF0000000"|tee $(obj)board/BuS/EB+MCF-EV123/textbase.mk
|
|
|
|
|
@$(MKCONFIG) EB+MCF-EV123 m68k mcf52x2 EB+MCF-EV123 BuS
|
|
|
|
|
|
|
|
|
|
EP2500_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 ep2500 Mercury
|
|
|
|
|
|
|
|
|
|
idmr_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 idmr
|
|
|
|
|
|
|
|
|
|
M5271EVB_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 m5271evb freescale
|
|
|
|
|
|
|
|
|
|
M5272C3_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 m5272c3 freescale
|
|
|
|
|
|
|
|
|
|
M5275EVB_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 m5275evb freescale
|
|
|
|
|
|
|
|
|
|
M5282EVB_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 m5282evb freescale
|
|
|
|
|
|
|
|
|
|
M53017EVB_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf532x m53017evb freescale
|
|
|
|
|
|
Added M5329AFEE and M5329BFEE Platforms
Added board/freescale/m5329evb, cpu/mcf532x, drivers/net,
drivers/serial, immap_5329.h, m5329.h, mcfrtc.h,
include/configs/M5329EVB.h, lib_m68k/interrupts.c, and
rtc/mcfrtc.c
Modified CREDITS, MAKEFILE, Makefile, README, common/cmd_bdinfo.c,
common/cmd_mii.c, include/asm-m68k/byteorder.h, include/asm-m68k/fec.h,
include/asm-m68k/io.h, include/asm-m68k/mcftimer.h,
include/asm-m68k/mcfuart.h, include/asm-m68k/ptrace.h,
include/asm-m68k/u-boot.h, lib_m68k/Makefile, lib_m68k/board.c,
lib_m68k/time.c, net/eth.c and rtc/Makefile
Signed-off-by: TsiChung Liew <Tsi-Chung.Liew@freescale.com>
18 years ago
|
|
|
M5329AFEE_config \
|
|
|
|
|
M5329BFEE_config : unconfig
|
|
|
|
|
@case "$@" in \
|
|
|
|
|
M5329AFEE_config) NAND=0;; \
|
|
|
|
|
M5329BFEE_config) NAND=16;; \
|
|
|
|
|
esac; \
|
|
|
|
|
if [ "$${NAND}" != "0" ] ; then \
|
|
|
|
|
echo "#define NANDFLASH_SIZE $${NAND}" > $(obj)include/config.h ; \
|
Added M5329AFEE and M5329BFEE Platforms
Added board/freescale/m5329evb, cpu/mcf532x, drivers/net,
drivers/serial, immap_5329.h, m5329.h, mcfrtc.h,
include/configs/M5329EVB.h, lib_m68k/interrupts.c, and
rtc/mcfrtc.c
Modified CREDITS, MAKEFILE, Makefile, README, common/cmd_bdinfo.c,
common/cmd_mii.c, include/asm-m68k/byteorder.h, include/asm-m68k/fec.h,
include/asm-m68k/io.h, include/asm-m68k/mcftimer.h,
include/asm-m68k/mcfuart.h, include/asm-m68k/ptrace.h,
include/asm-m68k/u-boot.h, lib_m68k/Makefile, lib_m68k/board.c,
lib_m68k/time.c, net/eth.c and rtc/Makefile
Signed-off-by: TsiChung Liew <Tsi-Chung.Liew@freescale.com>
18 years ago
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a M5329EVB m68k mcf532x m5329evb freescale
|
|
|
|
|
|
|
|
|
|
M5373EVB_config : unconfig
|
|
|
|
|
@case "$@" in \
|
|
|
|
|
M5373EVB_config) NAND=16;; \
|
|
|
|
|
esac; \
|
|
|
|
|
if [ "$${NAND}" != "0" ] ; then \
|
|
|
|
|
echo "#define NANDFLASH_SIZE $${NAND}" > $(obj)include/config.h ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a M5373EVB m68k mcf532x m5373evb freescale
|
|
|
|
|
|
|
|
|
|
M54451EVB_config \
|
|
|
|
|
M54451EVB_stmicro_config : unconfig
|
|
|
|
|
@case "$@" in \
|
|
|
|
|
M54451EVB_config) FLASH=NOR;; \
|
|
|
|
|
M54451EVB_stmicro_config) FLASH=STMICRO;; \
|
|
|
|
|
esac; \
|
|
|
|
|
if [ "$${FLASH}" = "NOR" ] ; then \
|
|
|
|
|
echo "TEXT_BASE = 0x00000000" > $(obj)board/freescale/m54451evb/config.tmp ; \
|
|
|
|
|
cp $(obj)board/freescale/m54451evb/u-boot.spa $(obj)board/freescale/m54451evb/u-boot.lds ; \
|
|
|
|
|
$(XECHO) "... with NOR boot..." ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${FLASH}" = "STMICRO" ] ; then \
|
|
|
|
|
echo "#define CONFIG_CF_SBF" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_SYS_STMICRO_BOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0x47E00000" > $(obj)board/freescale/m54451evb/config.tmp ; \
|
|
|
|
|
cp $(obj)board/freescale/m54451evb/u-boot.stm $(obj)board/freescale/m54451evb/u-boot.lds ; \
|
|
|
|
|
$(XECHO) "... with ST Micro boot..." ; \
|
|
|
|
|
fi; \
|
|
|
|
|
echo "#define CONFIG_SYS_INPUT_CLKSRC 24000000" >> $(obj)include/config.h ;
|
|
|
|
|
@$(MKCONFIG) -a M54451EVB m68k mcf5445x m54451evb freescale
|
|
|
|
|
|
|
|
|
|
M54455EVB_config \
|
|
|
|
|
M54455EVB_atmel_config \
|
|
|
|
|
M54455EVB_intel_config \
|
|
|
|
|
M54455EVB_a33_config \
|
|
|
|
|
M54455EVB_a66_config \
|
|
|
|
|
M54455EVB_i33_config \
|
|
|
|
|
M54455EVB_i66_config \
|
|
|
|
|
M54455EVB_stm33_config : unconfig
|
|
|
|
|
@case "$@" in \
|
|
|
|
|
M54455EVB_config) FLASH=ATMEL; FREQ=33333333;; \
|
|
|
|
|
M54455EVB_atmel_config) FLASH=ATMEL; FREQ=33333333;; \
|
|
|
|
|
M54455EVB_intel_config) FLASH=INTEL; FREQ=33333333;; \
|
|
|
|
|
M54455EVB_a33_config) FLASH=ATMEL; FREQ=33333333;; \
|
|
|
|
|
M54455EVB_a66_config) FLASH=ATMEL; FREQ=66666666;; \
|
|
|
|
|
M54455EVB_i33_config) FLASH=INTEL; FREQ=33333333;; \
|
|
|
|
|
M54455EVB_i66_config) FLASH=INTEL; FREQ=66666666;; \
|
|
|
|
|
M54455EVB_stm33_config) FLASH=STMICRO; FREQ=33333333;; \
|
|
|
|
|
esac; \
|
|
|
|
|
if [ "$${FLASH}" = "INTEL" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_INTEL_BOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0x00000000" > $(obj)board/freescale/m54455evb/config.tmp ; \
|
|
|
|
|
cp $(obj)board/freescale/m54455evb/u-boot.int $(obj)board/freescale/m54455evb/u-boot.lds ; \
|
|
|
|
|
$(XECHO) "... with INTEL boot..." ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${FLASH}" = "ATMEL" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_ATMEL_BOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0x04000000" > $(obj)board/freescale/m54455evb/config.tmp ; \
|
|
|
|
|
cp $(obj)board/freescale/m54455evb/u-boot.atm $(obj)board/freescale/m54455evb/u-boot.lds ; \
|
|
|
|
|
$(XECHO) "... with ATMEL boot..." ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${FLASH}" = "STMICRO" ] ; then \
|
|
|
|
|
echo "#define CONFIG_CF_SBF" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_SYS_STMICRO_BOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0x4FE00000" > $(obj)board/freescale/m54455evb/config.tmp ; \
|
|
|
|
|
cp $(obj)board/freescale/m54455evb/u-boot.stm $(obj)board/freescale/m54455evb/u-boot.lds ; \
|
|
|
|
|
$(XECHO) "... with ST Micro boot..." ; \
|
|
|
|
|
fi; \
|
|
|
|
|
echo "#define CONFIG_SYS_INPUT_CLKSRC $${FREQ}" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with $${FREQ}Hz input clock"
|
|
|
|
|
@$(MKCONFIG) -a M54455EVB m68k mcf5445x m54455evb freescale
|
|
|
|
|
|
|
|
|
|
M5475AFE_config \
|
|
|
|
|
M5475BFE_config \
|
|
|
|
|
M5475CFE_config \
|
|
|
|
|
M5475DFE_config \
|
|
|
|
|
M5475EFE_config \
|
|
|
|
|
M5475FFE_config \
|
|
|
|
|
M5475GFE_config : unconfig
|
|
|
|
|
@case "$@" in \
|
|
|
|
|
M5475AFE_config) BOOT=2;CODE=0;VID=0;USB=0;RAM=64;RAM1=0;; \
|
|
|
|
|
M5475BFE_config) BOOT=2;CODE=16;VID=0;USB=0;RAM=64;RAM1=0;; \
|
|
|
|
|
M5475CFE_config) BOOT=2;CODE=16;VID=1;USB=1;RAM=64;RAM1=0;; \
|
|
|
|
|
M5475DFE_config) BOOT=2;CODE=0;VID=0;USB=1;RAM=64;RAM1=0;; \
|
|
|
|
|
M5475EFE_config) BOOT=2;CODE=0;VID=1;USB=1;RAM=64;RAM1=0;; \
|
|
|
|
|
M5475FFE_config) BOOT=2;CODE=32;VID=1;USB=1;RAM=64;RAM1=64;; \
|
|
|
|
|
M5475GFE_config) BOOT=4;CODE=0;VID=0;USB=0;RAM=64;RAM1=0;; \
|
|
|
|
|
esac; \
|
|
|
|
|
echo "#define CONFIG_SYS_BUSCLK 133333333" > $(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_SYS_BOOTSZ $${BOOT}" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_SYS_DRAMSZ $${RAM}" >> $(obj)include/config.h ; \
|
|
|
|
|
if [ "$${RAM1}" != "0" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_DRAMSZ1 $${RAM1}" >> $(obj)include/config.h ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${CODE}" != "0" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_NOR1SZ $${CODE}" >> $(obj)include/config.h ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${VID}" == "1" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_VIDEO" >> $(obj)include/config.h ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${USB}" == "1" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USBCTRL" >> $(obj)include/config.h ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a M5475EVB m68k mcf547x_8x m547xevb freescale
|
|
|
|
|
|
|
|
|
|
M5485AFE_config \
|
|
|
|
|
M5485BFE_config \
|
|
|
|
|
M5485CFE_config \
|
|
|
|
|
M5485DFE_config \
|
|
|
|
|
M5485EFE_config \
|
|
|
|
|
M5485FFE_config \
|
|
|
|
|
M5485GFE_config \
|
|
|
|
|
M5485HFE_config : unconfig
|
|
|
|
|
@case "$@" in \
|
|
|
|
|
M5485AFE_config) BOOT=2;CODE=0;VID=0;USB=0;RAM=64;RAM1=0;; \
|
|
|
|
|
M5485BFE_config) BOOT=2;CODE=16;VID=0;USB=0;RAM=64;RAM1=0;; \
|
|
|
|
|
M5485CFE_config) BOOT=2;CODE=16;VID=1;USB=1;RAM=64;RAM1=0;; \
|
|
|
|
|
M5485DFE_config) BOOT=2;CODE=0;VID=0;USB=1;RAM=64;RAM1=0;; \
|
|
|
|
|
M5485EFE_config) BOOT=2;CODE=0;VID=1;USB=1;RAM=64;RAM1=0;; \
|
|
|
|
|
M5485FFE_config) BOOT=2;CODE=32;VID=1;USB=1;RAM=64;RAM1=64;; \
|
|
|
|
|
M5485GFE_config) BOOT=4;CODE=0;VID=0;USB=0;RAM=64;RAM1=0;; \
|
|
|
|
|
M5485HFE_config) BOOT=2;CODE=16;VID=1;USB=0;RAM=64;RAM1=0;; \
|
|
|
|
|
esac; \
|
|
|
|
|
echo "#define CONFIG_SYS_BUSCLK 100000000" > $(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_SYS_BOOTSZ $${BOOT}" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_SYS_DRAMSZ $${RAM}" >> $(obj)include/config.h ; \
|
|
|
|
|
if [ "$${RAM1}" != "0" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_DRAMSZ1 $${RAM1}" >> $(obj)include/config.h ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${CODE}" != "0" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_NOR1SZ $${CODE}" >> $(obj)include/config.h ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${VID}" == "1" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_VIDEO" >> $(obj)include/config.h ; \
|
|
|
|
|
fi; \
|
|
|
|
|
if [ "$${USB}" == "1" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USBCTRL" >> $(obj)include/config.h ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a M5485EVB m68k mcf547x_8x m548xevb freescale
|
|
|
|
|
|
|
|
|
|
TASREG_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) m68k mcf52x2 tasreg esd
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC83xx Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
kmeter1_config: unconfig
|
|
|
|
|
@$(MKCONFIG) kmeter1 ppc mpc83xx kmeter1 keymile
|
|
|
|
|
|
|
|
|
|
MPC8313ERDB_33_config \
|
|
|
|
|
MPC8313ERDB_66_config \
|
|
|
|
|
MPC8313ERDB_NAND_33_config \
|
|
|
|
|
MPC8313ERDB_NAND_66_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/freescale/mpc8313erdb
|
|
|
|
|
@if [ "$(findstring _33_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...33M ..." ; \
|
|
|
|
|
echo "#define CONFIG_SYS_33MHZ" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _66_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...66M..." ; \
|
|
|
|
|
echo "#define CONFIG_SYS_66MHZ" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _NAND_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...NAND..." ; \
|
|
|
|
|
echo "TEXT_BASE = 0x00100000" > $(obj)board/freescale/mpc8313erdb/config.tmp ; \
|
|
|
|
|
echo "#define CONFIG_NAND_U_BOOT" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ;
|
|
|
|
|
@$(MKCONFIG) -a MPC8313ERDB ppc mpc83xx mpc8313erdb freescale
|
|
|
|
|
@if [ "$(findstring _NAND_,$@)" ] ; then \
|
|
|
|
|
echo "CONFIG_NAND_U_BOOT = y" >> $(obj)include/config.mk ; \
|
|
|
|
|
fi ;
|
|
|
|
|
|
|
|
|
|
MPC8315ERDB_NAND_config \
|
|
|
|
|
MPC8315ERDB_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) MPC8315ERDB ppc mpc83xx mpc8315erdb freescale
|
|
|
|
|
|
|
|
|
|
MPC8323ERDB_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a MPC8323ERDB ppc mpc83xx mpc8323erdb freescale
|
|
|
|
|
|
|
|
|
|
MPC832XEMDS_config \
|
|
|
|
|
MPC832XEMDS_HOST_33_config \
|
|
|
|
|
MPC832XEMDS_HOST_66_config \
|
|
|
|
|
MPC832XEMDS_SLAVE_config \
|
|
|
|
|
MPC832XEMDS_ATM_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _HOST_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "... PCI HOST " ; \
|
|
|
|
|
echo "#define CONFIG_PCI" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _SLAVE_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) "...PCI SLAVE 66M" ; \
|
|
|
|
|
echo "#define CONFIG_PCI" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_PCISLAVE" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _33_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...33M ..." ; \
|
|
|
|
|
echo "#define PCI_33M" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_PQ_MDS_PIB 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _66_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...66M..." ; \
|
|
|
|
|
echo "#define PCI_66M" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_PQ_MDS_PIB 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _ATM_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...ATM..." ; \
|
|
|
|
|
echo "#define CONFIG_PQ_MDS_PIB 1" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_PQ_MDS_PIB_ATM 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ;
|
|
|
|
|
@$(MKCONFIG) -a MPC832XEMDS ppc mpc83xx mpc832xemds freescale
|
|
|
|
|
|
|
|
|
|
MPC8349EMDS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc83xx mpc8349emds freescale
|
|
|
|
|
|
|
|
|
|
MPC8349ITX_config \
|
|
|
|
|
MPC8349ITX_LOWBOOT_config \
|
|
|
|
|
MPC8349ITXGP_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/freescale/mpc8349itx
|
|
|
|
|
@echo "#define CONFIG_$(subst _LOWBOOT,,$(@:_config=))" >> $(obj)include/config.h
|
|
|
|
|
@if [ "$(findstring GP,$@)" ] ; then \
|
|
|
|
|
echo "TEXT_BASE = 0xFE000000" >$(obj)board/freescale/mpc8349itx/config.tmp ; \
|
|
|
|
|
fi
|
|
|
|
|
@if [ "$(findstring LOWBOOT,$@)" ] ; then \
|
|
|
|
|
echo "TEXT_BASE = 0xFE000000" >$(obj)board/freescale/mpc8349itx/config.tmp ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a -n $(@:_config=) MPC8349ITX ppc mpc83xx mpc8349itx freescale
|
|
|
|
|
|
|
|
|
|
MPC8360EMDS_config \
|
|
|
|
|
MPC8360EMDS_HOST_33_config \
|
|
|
|
|
MPC8360EMDS_HOST_66_config \
|
|
|
|
|
MPC8360EMDS_SLAVE_config \
|
|
|
|
|
MPC8360EMDS_ATM_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _HOST_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "... PCI HOST " ; \
|
|
|
|
|
echo "#define CONFIG_PCI" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _SLAVE_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) "...PCI SLAVE 66M" ; \
|
|
|
|
|
echo "#define CONFIG_PCI" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_PCISLAVE" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _33_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...33M ..." ; \
|
|
|
|
|
echo "#define PCI_33M" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_PQ_MDS_PIB 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _66_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...66M..." ; \
|
|
|
|
|
echo "#define PCI_66M" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_PQ_MDS_PIB 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _ATM_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...ATM..." ; \
|
|
|
|
|
echo "#define CONFIG_PQ_MDS_PIB 1" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_PQ_MDS_PIB_ATM 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ;
|
|
|
|
|
@$(MKCONFIG) -a MPC8360EMDS ppc mpc83xx mpc8360emds freescale
|
|
|
|
|
|
|
|
|
|
MPC8360ERDK_33_config \
|
|
|
|
|
MPC8360ERDK_66_config \
|
|
|
|
|
MPC8360ERDK_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _33_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "... CLKIN 33MHz " ; \
|
|
|
|
|
echo "#define CONFIG_CLKIN_33MHZ" >>$(obj)include/config.h ;\
|
|
|
|
|
fi ;
|
|
|
|
|
@$(MKCONFIG) -a MPC8360ERDK ppc mpc83xx mpc8360erdk freescale
|
|
|
|
|
|
|
|
|
|
MPC837XEMDS_config \
|
|
|
|
|
MPC837XEMDS_HOST_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _HOST_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "... PCI HOST " ; \
|
|
|
|
|
echo "#define CONFIG_PCI" >>$(obj)include/config.h ; \
|
|
|
|
|
fi ;
|
|
|
|
|
@$(MKCONFIG) -a MPC837XEMDS ppc mpc83xx mpc837xemds freescale
|
|
|
|
|
|
|
|
|
|
MPC837XERDB_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -a MPC837XERDB ppc mpc83xx mpc837xerdb freescale
|
|
|
|
|
|
|
|
|
|
MVBLM7_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc83xx mvblm7 matrix_vision
|
|
|
|
|
|
|
|
|
|
sbc8349_config \
|
|
|
|
|
sbc8349_PCI_33_config \
|
|
|
|
|
sbc8349_PCI_66_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) sbc8349 ppc mpc83xx sbc8349
|
|
|
|
|
|
|
|
|
|
SIMPC8313_LP_config \
|
|
|
|
|
SIMPC8313_SP_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/sheldon/simpc8313
|
|
|
|
|
@if [ "$(findstring _LP_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...Large Page NAND..." ; \
|
|
|
|
|
echo "#define CONFIG_NAND_LP" >> $(obj)include/config.h ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _SP_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) -n "...Small Page NAND..." ; \
|
|
|
|
|
echo "#define CONFIG_NAND_SP" >> $(obj)include/config.h ; \
|
|
|
|
|
fi ;
|
|
|
|
|
@$(MKCONFIG) -a SIMPC8313 ppc mpc83xx simpc8313 sheldon
|
|
|
|
|
@echo "CONFIG_NAND_U_BOOT = y" >> $(obj)include/config.mk
|
|
|
|
|
|
|
|
|
|
TQM834x_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc83xx tqm834x tqc
|
|
|
|
|
|
|
|
|
|
caddy2_config \
|
|
|
|
|
vme8349_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) vme8349 ppc mpc83xx vme8349 esd
|
|
|
|
|
|
|
|
|
|
edb9301_config \
|
|
|
|
|
edb9302_config \
|
|
|
|
|
edb9302a_config \
|
|
|
|
|
edb9307_config \
|
|
|
|
|
edb9307a_config \
|
|
|
|
|
edb9312_config \
|
|
|
|
|
edb9315_config \
|
|
|
|
|
edb9315a_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) edb93xx arm arm920t edb93xx NULL ep93xx
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC85xx Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
ATUM8548_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx atum8548
|
|
|
|
|
|
NAND boot: MPC8536DS support
MPC8536E can support booting from NAND flash which uses the
image u-boot-nand.bin. This image contains two parts: a 4K
NAND loader and a main U-Boot image. The former is appended
to the latter to produce u-boot-nand.bin. The 4K NAND loader
includes the corresponding nand_spl directory, along with the
code twisted by CONFIG_NAND_SPL. The main U-Boot image just
like a general U-Boot image except the parts that included by
CONFIG_SYS_RAMBOOT.
When power on, eLBC will automatically load from bank 0 the
4K NAND loader into the FCM buffer RAM where CPU can execute
the boot code directly. In the first stage, the NAND loader
copies itself to RAM or L2SRAM to free up the FCM buffer RAM,
then loads the main image from NAND flash to RAM or L2SRAM
and boot from it.
This patch implements the NAND loader to load the main image
into L2SRAM, so the main image can configure the RAM by using
SPD EEPROM. In the first stage, the NAND loader copies itself
to the second to last 4K address space, and uses the last 4K
address space as the initial RAM for stack.
Obviously, the size of L2SRAM shouldn't be less than the size
of the image used. If so, the workaround is to generate another
image that includes the code to configure the RAM by SPD and
load it to L2SRAM first, then relocate the main image to RAM
to boot up.
Signed-off-by: Mingkai Hu <Mingkai.hu@freescale.com>
Signed-off-by: Kumar Gala <galak@kernel.crashing.org>
15 years ago
|
|
|
MPC8536DS_NAND_config \
|
On-chip ROM boot: MPC8536DS support
The MPC8536E is capable of booting from the on-chip ROM - boot from
eSDHC and boot from eSPI. When power on, the porcessor excutes the
ROM code to initialize the eSPI/eSDHC controller, and loads the mian
U-Boot image from the memory device that interfaced to the controller,
such as the SDCard or SPI EEPROM, to the target memory, e.g. SDRAM or
L2SRAM, then boot from it.
The memory device should contain a specific data structure with control
word and config word at the fixed address. The config word direct the
process how to config the memory device, and the control word direct
the processor where to find the image on the memory device, or where
copy the main image to. The user can use any method to store the data
structure to the memory device, only if store it on the assigned address.
The on-chip ROM code will map the whole 4GB address space by setting
entry0 in the TLB1, so the main image need to switch to Address space 1
to disable this mapping and map the address space again.
This patch implements loading the mian U-Boot image into L2SRAM, so
the image can configure the system memory by using SPD EEPROM.
Signed-off-by: Mingkai Hu <Mingkai.hu@freescale.com>
Signed-off-by: Kumar Gala <galak@kernel.crashing.org>
15 years ago
|
|
|
MPC8536DS_SDCARD_config \
|
|
|
|
|
MPC8536DS_SPIFLASH_config \
|
|
|
|
|
MPC8536DS_36BIT_config \
|
|
|
|
|
MPC8536DS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) MPC8536DS ppc mpc85xx mpc8536ds freescale
|
|
|
|
|
|
|
|
|
|
MPC8540ADS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8540ads freescale
|
|
|
|
|
|
|
|
|
|
MPC8540EVAL_config \
|
|
|
|
|
MPC8540EVAL_33_config \
|
|
|
|
|
MPC8540EVAL_66_config \
|
|
|
|
|
MPC8540EVAL_33_slave_config \
|
|
|
|
|
MPC8540EVAL_66_slave_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _33_,$@)" ] ; then \
|
|
|
|
|
$(XECHO) "... 33 MHz PCI" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_SYSCLK_66M" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... 66 MHz PCI" ; \
|
|
|
|
|
fi ; \
|
|
|
|
|
if [ "$(findstring _slave_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_PCI_SLAVE" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) " slave" ; \
|
|
|
|
|
else \
|
|
|
|
|
$(XECHO) " host" ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a MPC8540EVAL ppc mpc85xx mpc8540eval
|
|
|
|
|
|
|
|
|
|
MPC8560ADS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8560ads freescale
|
|
|
|
|
|
|
|
|
|
MPC8541CDS_legacy_config \
|
|
|
|
|
MPC8541CDS_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _legacy_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_LEGACY" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... legacy" ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a MPC8541CDS ppc mpc85xx mpc8541cds freescale
|
|
|
|
|
|
|
|
|
|
MPC8544DS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8544ds freescale
|
|
|
|
|
|
|
|
|
|
MPC8548CDS_legacy_config \
|
|
|
|
|
MPC8548CDS_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _legacy_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_LEGACY" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... legacy" ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a MPC8548CDS ppc mpc85xx mpc8548cds freescale
|
|
|
|
|
|
|
|
|
|
MPC8555CDS_legacy_config \
|
|
|
|
|
MPC8555CDS_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _legacy_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_LEGACY" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... legacy" ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a MPC8555CDS ppc mpc85xx mpc8555cds freescale
|
|
|
|
|
|
|
|
|
|
MPC8568MDS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8568mds freescale
|
|
|
|
|
|
|
|
|
|
MPC8569MDS_ATM_config \
|
|
|
|
|
MPC8569MDS_NAND_config \
|
|
|
|
|
MPC8569MDS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) MPC8569MDS ppc mpc85xx mpc8569mds freescale
|
|
|
|
|
|
|
|
|
|
MPC8572DS_36BIT_config \
|
|
|
|
|
MPC8572DS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) MPC8572DS ppc mpc85xx mpc8572ds freescale
|
|
|
|
|
|
|
|
|
|
P2020DS_36BIT_config \
|
|
|
|
|
P2020DS_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) P2020DS ppc mpc85xx p2020ds freescale
|
|
|
|
|
|
|
|
|
|
P1011RDB_config \
|
|
|
|
|
P1011RDB_NAND_config \
|
|
|
|
|
P1011RDB_SDCARD_config \
|
|
|
|
|
P1011RDB_SPIFLASH_config \
|
|
|
|
|
P1020RDB_config \
|
|
|
|
|
P1020RDB_NAND_config \
|
|
|
|
|
P1020RDB_SDCARD_config \
|
|
|
|
|
P1020RDB_SPIFLASH_config \
|
|
|
|
|
P2010RDB_config \
|
|
|
|
|
P2010RDB_NAND_config \
|
|
|
|
|
P2010RDB_SDCARD_config \
|
|
|
|
|
P2010RDB_SPIFLASH_config \
|
|
|
|
|
P2020RDB_config \
|
|
|
|
|
P2020RDB_NAND_config \
|
|
|
|
|
P2020RDB_SDCARD_config \
|
|
|
|
|
P2020RDB_SPIFLASH_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) P1_P2_RDB ppc mpc85xx p1_p2_rdb freescale
|
|
|
|
|
|
|
|
|
|
PM854_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx pm854
|
|
|
|
|
|
|
|
|
|
PM856_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx pm856
|
|
|
|
|
|
|
|
|
|
sbc8540_config \
|
|
|
|
|
sbc8540_33_config \
|
|
|
|
|
sbc8540_66_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) SBC8540 ppc mpc85xx sbc8560
|
|
|
|
|
|
|
|
|
|
sbc8548_config \
|
|
|
|
|
sbc8548_PCI_33_config \
|
|
|
|
|
sbc8548_PCI_66_config \
|
|
|
|
|
sbc8548_PCI_33_PCIE_config \
|
|
|
|
|
sbc8548_PCI_66_PCIE_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) sbc8548 ppc mpc85xx sbc8548
|
|
|
|
|
|
|
|
|
|
sbc8560_config \
|
|
|
|
|
sbc8560_33_config \
|
|
|
|
|
sbc8560_66_config: unconfig
|
|
|
|
|
@$(MKCONFIG) -t $(@:_config=) sbc8560 ppc mpc85xx sbc8560
|
|
|
|
|
|
|
|
|
|
socrates_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx socrates
|
|
|
|
|
|
|
|
|
|
stxgp3_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx stxgp3 stx
|
|
|
|
|
|
|
|
|
|
stxssa_config \
|
|
|
|
|
stxssa_4M_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _4M_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_STXSSA_4M" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 4 MiB flash memory" ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a stxssa ppc mpc85xx stxssa stx
|
|
|
|
|
|
|
|
|
|
TQM8540_config \
|
|
|
|
|
TQM8541_config \
|
|
|
|
|
TQM8548_config \
|
|
|
|
|
TQM8548_AG_config \
|
|
|
|
|
TQM8548_BE_config \
|
|
|
|
|
TQM8555_config \
|
|
|
|
|
TQM8560_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@BTYPE=$(@:_config=); \
|
|
|
|
|
CTYPE=$(subst TQM,,$(subst _AG,,$(subst _BE,,$(@:_config=)))); \
|
|
|
|
|
$(XECHO) "... "$${BTYPE}" (MPC"$${CTYPE}")"; \
|
|
|
|
|
echo "#define CONFIG_MPC$${CTYPE}">>$(obj)include/config.h; \
|
|
|
|
|
echo "#define CONFIG_$${BTYPE}">>$(obj)include/config.h; \
|
|
|
|
|
echo "#define CONFIG_HOSTNAME tqm$${CTYPE}">>$(obj)include/config.h; \
|
|
|
|
|
echo "#define CONFIG_BOARDNAME \"$${BTYPE}\"">>$(obj)include/config.h;
|
|
|
|
|
@$(MKCONFIG) -a TQM85xx ppc mpc85xx tqm85xx tqc
|
|
|
|
|
@echo "CONFIG_$(@:_config=) = y">>$(obj)include/config.mk;
|
|
|
|
|
|
|
|
|
|
XPEDITE5200_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx xpedite5200 xes
|
|
|
|
|
|
|
|
|
|
XPEDITE5370_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc85xx xpedite5370 xes
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MPC86xx Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
MPC8610HPCD_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc86xx mpc8610hpcd freescale
|
|
|
|
|
|
|
|
|
|
MPC8641HPCN_36BIT_config \
|
|
|
|
|
MPC8641HPCN_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _36BIT_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_PHYS_64BIT" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... enabling 36-bit physical addressing." ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a MPC8641HPCN ppc mpc86xx mpc8641hpcn freescale
|
|
|
|
|
|
|
|
|
|
sbc8641d_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc86xx sbc8641d
|
|
|
|
|
|
|
|
|
|
XPEDITE5170_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc mpc86xx xpedite5170 xes
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## 74xx/7xx Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
AmigaOneG3SE_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc 74xx_7xx AmigaOneG3SE MAI
|
|
|
|
|
|
|
|
|
|
BAB7xx_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc 74xx_7xx bab7xx eltec
|
|
|
|
|
|
|
|
|
|
CPCI750_config: unconfig
|
|
|
|
|
@$(MKCONFIG) CPCI750 ppc 74xx_7xx cpci750 esd
|
|
|
|
|
|
|
|
|
|
DB64360_config: unconfig
|
|
|
|
|
@$(MKCONFIG) DB64360 ppc 74xx_7xx db64360 Marvell
|
|
|
|
|
|
|
|
|
|
DB64460_config: unconfig
|
|
|
|
|
@$(MKCONFIG) DB64460 ppc 74xx_7xx db64460 Marvell
|
|
|
|
|
|
|
|
|
|
ELPPC_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc 74xx_7xx elppc eltec
|
|
|
|
|
|
|
|
|
|
EVB64260_config \
|
|
|
|
|
EVB64260_750CX_config: unconfig
|
|
|
|
|
@$(MKCONFIG) EVB64260 ppc 74xx_7xx evb64260
|
|
|
|
|
|
|
|
|
|
mpc7448hpc2_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc 74xx_7xx mpc7448hpc2 freescale
|
|
|
|
|
|
|
|
|
|
P3G4_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc 74xx_7xx evb64260
|
|
|
|
|
|
|
|
|
|
p3m750_config \
|
|
|
|
|
p3m7448_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring 750_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_P3M750" >>$(obj)include/config.h ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_P3M7448" >>$(obj)include/config.h ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a p3mx ppc 74xx_7xx p3mx prodrive
|
|
|
|
|
|
|
|
|
|
PCIPPC2_config \
|
|
|
|
|
PCIPPC6_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc 74xx_7xx pcippc2
|
|
|
|
|
|
|
|
|
|
ppmc7xx_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc 74xx_7xx ppmc7xx
|
|
|
|
|
|
|
|
|
|
ZUMA_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) ppc 74xx_7xx evb64260
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
# ARM
|
|
|
|
|
#========================================================================
|
|
|
|
|
#########################################################################
|
|
|
|
|
## StrongARM Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
assabet_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm sa1100 assabet
|
|
|
|
|
|
|
|
|
|
dnp1110_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm sa1100 dnp1110
|
|
|
|
|
|
|
|
|
|
gcplus_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm sa1100 gcplus
|
|
|
|
|
|
|
|
|
|
lart_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm sa1100 lart
|
|
|
|
|
|
|
|
|
|
shannon_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm sa1100 shannon
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## ARM92xT Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
a320evb_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t a320evb faraday a320
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## Atmel AT91RM9200 Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
at91rm9200dk_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t at91rm9200dk atmel at91rm9200
|
|
|
|
|
|
|
|
|
|
at91rm9200ek_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t at91rm9200ek atmel at91rm9200
|
|
|
|
|
|
|
|
|
|
cmc_pu2_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t cmc_pu2 NULL at91rm9200
|
|
|
|
|
|
|
|
|
|
CPUAT91_RAM_config \
|
|
|
|
|
CPUAT91_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_$(@:_config=) 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a cpuat91 arm arm920t cpuat91 eukrea at91rm9200
|
|
|
|
|
|
|
|
|
|
csb637_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t csb637 NULL at91rm9200
|
|
|
|
|
|
|
|
|
|
eb_cpux9k2_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t eb_cpux9k2 BuS at91
|
|
|
|
|
|
|
|
|
|
kb9202_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t kb9202 NULL at91rm9200
|
|
|
|
|
|
|
|
|
|
m501sk_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t m501sk NULL at91rm9200
|
|
|
|
|
|
|
|
|
|
mp2usb_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t mp2usb NULL at91rm9200
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## ARM926EJ-S Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
afeb9260_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs afeb9260 NULL at91
|
|
|
|
|
|
|
|
|
|
at91cap9adk_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs at91cap9adk atmel at91
|
|
|
|
|
|
|
|
|
|
at91sam9260ek_nandflash_config \
|
|
|
|
|
at91sam9260ek_dataflash_cs0_config \
|
|
|
|
|
at91sam9260ek_dataflash_cs1_config \
|
|
|
|
|
at91sam9260ek_config \
|
|
|
|
|
at91sam9g20ek_nandflash_config \
|
|
|
|
|
at91sam9g20ek_dataflash_cs0_config \
|
|
|
|
|
at91sam9g20ek_dataflash_cs1_config \
|
|
|
|
|
at91sam9g20ek_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring 9g20,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_AT91SAM9G20EK 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... 9G20 Variant" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_AT91SAM9260EK 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi;
|
|
|
|
|
@if [ "$(findstring _nandflash,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_NANDFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in NAND FLASH" ; \
|
|
|
|
|
elif [ "$(findstring dataflash_cs0,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_DATAFLASH_CS0 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in SPI DATAFLASH CS0" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_DATAFLASH_CS1 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in SPI DATAFLASH CS1" ; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) -a at91sam9260ek arm arm926ejs at91sam9260ek atmel at91
|
|
|
|
|
|
|
|
|
|
at91sam9xeek_nandflash_config \
|
|
|
|
|
at91sam9xeek_dataflash_cs0_config \
|
|
|
|
|
at91sam9xeek_dataflash_cs1_config \
|
|
|
|
|
at91sam9xeek_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _nandflash,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_NANDFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in NAND FLASH" ; \
|
|
|
|
|
elif [ "$(findstring dataflash_cs0,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_DATAFLASH_CS0 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in SPI DATAFLASH CS0" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_DATAFLASH_CS1 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in SPI DATAFLASH CS1" ; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) -n at91sam9xeek -a at91sam9260ek arm arm926ejs at91sam9260ek atmel at91
|
|
|
|
|
|
|
|
|
|
at91sam9261ek_nandflash_config \
|
|
|
|
|
at91sam9261ek_dataflash_cs0_config \
|
|
|
|
|
at91sam9261ek_dataflash_cs3_config \
|
|
|
|
|
at91sam9261ek_config \
|
|
|
|
|
at91sam9g10ek_nandflash_config \
|
|
|
|
|
at91sam9g10ek_dataflash_cs0_config \
|
|
|
|
|
at91sam9g10ek_dataflash_cs3_config \
|
|
|
|
|
at91sam9g10ek_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring 9g10,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_AT91SAM9G10EK 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... 9G10 Variant" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_AT91SAM9261EK 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi;
|
|
|
|
|
@if [ "$(findstring _nandflash,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_NANDFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in NAND FLASH" ; \
|
|
|
|
|
elif [ "$(findstring dataflash_cs0,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_DATAFLASH_CS3 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in SPI DATAFLASH CS3" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_DATAFLASH_CS0 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in SPI DATAFLASH CS0" ; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) -a at91sam9261ek arm arm926ejs at91sam9261ek atmel at91
|
|
|
|
|
|
|
|
|
|
at91sam9263ek_norflash_config \
|
|
|
|
|
at91sam9263ek_norflash_boot_config \
|
|
|
|
|
at91sam9263ek_nandflash_config \
|
|
|
|
|
at91sam9263ek_dataflash_config \
|
|
|
|
|
at91sam9263ek_dataflash_cs0_config \
|
|
|
|
|
at91sam9263ek_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _nandflash,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_NANDFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in NAND FLASH" ; \
|
|
|
|
|
elif [ "$(findstring norflash,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_NORFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in NOR FLASH" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_DATAFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in SPI DATAFLASH CS0" ; \
|
|
|
|
|
fi;
|
|
|
|
|
@if [ "$(findstring norflash_boot,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_BOOT_NORFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... and boot from NOR FLASH" ; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) -a at91sam9263ek arm arm926ejs at91sam9263ek atmel at91
|
|
|
|
|
|
|
|
|
|
at91sam9rlek_nandflash_config \
|
|
|
|
|
at91sam9rlek_dataflash_config \
|
|
|
|
|
at91sam9rlek_dataflash_cs0_config \
|
|
|
|
|
at91sam9rlek_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _nandflash,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_NANDFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in NAND FLASH" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_DATAFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in SPI DATAFLASH CS0" ; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) -a at91sam9rlek arm arm926ejs at91sam9rlek atmel at91
|
|
|
|
|
|
|
|
|
|
CPU9G20_128M_config \
|
|
|
|
|
CPU9G20_config \
|
|
|
|
|
CPU9260_128M_config \
|
|
|
|
|
CPU9260_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_$(@:_config=) 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a cpu9260 arm arm926ejs cpu9260 eukrea at91
|
|
|
|
|
|
|
|
|
|
meesc_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs meesc esd at91
|
|
|
|
|
|
|
|
|
|
pm9261_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs pm9261 ronetix at91
|
|
|
|
|
|
|
|
|
|
at91sam9m10g45ek_nandflash_config \
|
|
|
|
|
at91sam9m10g45ek_dataflash_config \
|
|
|
|
|
at91sam9m10g45ek_dataflash_cs0_config \
|
|
|
|
|
at91sam9m10g45ek_config \
|
|
|
|
|
at91sam9g45ekes_nandflash_config \
|
|
|
|
|
at91sam9g45ekes_dataflash_config \
|
|
|
|
|
at91sam9g45ekes_dataflash_cs0_config \
|
|
|
|
|
at91sam9g45ekes_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring 9m10,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_AT91SAM9M10G45EK 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... 9M10G45 Variant" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_AT91SAM9G45EKES 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi;
|
|
|
|
|
|
|
|
|
|
@if [ "$(findstring _nandflash,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SYS_USE_NANDFLASH 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in NAND FLASH" ; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_ATMEL_SPI 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with environment variable in SPI DATAFLASH CS0" ; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) -a at91sam9m10g45ek arm arm926ejs at91sam9m10g45ek atmel at91
|
|
|
|
|
|
|
|
|
|
otc570_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs otc570 esd at91
|
|
|
|
|
|
|
|
|
|
pm9263_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs pm9263 ronetix at91
|
|
|
|
|
|
|
|
|
|
SBC35_A9G20_NANDFLASH_config \
|
|
|
|
|
SBC35_A9G20_EEPROM_config \
|
|
|
|
|
SBC35_A9G20_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_$(@:_config=) 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a sbc35_a9g20 arm arm926ejs sbc35_a9g20 calao at91
|
|
|
|
|
|
|
|
|
|
TNY_A9G20_NANDFLASH_config \
|
|
|
|
|
TNY_A9G20_EEPROM_config \
|
|
|
|
|
TNY_A9G20_config \
|
|
|
|
|
TNY_A9260_NANDFLASH_config \
|
|
|
|
|
TNY_A9260_EEPROM_config \
|
|
|
|
|
TNY_A9260_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_$(@:_config=) 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a tny_a9260 arm arm926ejs tny_a9260 calao at91
|
|
|
|
|
|
|
|
|
|
########################################################################
|
|
|
|
|
## ARM Integrator boards - see doc/README-integrator for more info.
|
|
|
|
|
integratorap_config \
|
|
|
|
|
ap_config \
|
|
|
|
|
ap966_config \
|
|
|
|
|
ap922_config \
|
|
|
|
|
ap922_XA10_config \
|
|
|
|
|
ap7_config \
|
|
|
|
|
ap720t_config \
|
|
|
|
|
ap920t_config \
|
|
|
|
|
ap926ejs_config \
|
|
|
|
|
ap946es_config: unconfig
|
|
|
|
|
@board/armltd/integrator/split_by_variant.sh ap $@
|
|
|
|
|
|
|
|
|
|
integratorcp_config \
|
|
|
|
|
cp_config \
|
|
|
|
|
cp920t_config \
|
|
|
|
|
cp926ejs_config \
|
|
|
|
|
cp946es_config \
|
|
|
|
|
cp1136_config \
|
|
|
|
|
cp966_config \
|
|
|
|
|
cp922_config \
|
|
|
|
|
cp922_XA10_config \
|
|
|
|
|
cp1026_config: unconfig
|
|
|
|
|
@board/armltd/integrator/split_by_variant.sh cp $@
|
|
|
|
|
|
|
|
|
|
da830evm_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs da830evm davinci davinci
|
|
|
|
|
|
|
|
|
|
davinci_dvevm_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs dvevm davinci davinci
|
|
|
|
|
|
|
|
|
|
davinci_schmoogie_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs schmoogie davinci davinci
|
|
|
|
|
|
|
|
|
|
davinci_sffsdr_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs sffsdr davinci davinci
|
|
|
|
|
|
|
|
|
|
davinci_sonata_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs sonata davinci davinci
|
|
|
|
|
|
|
|
|
|
davinci_dm355evm_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs dm355evm davinci davinci
|
|
|
|
|
|
|
|
|
|
davinci_dm355leopard_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs dm355leopard davinci davinci
|
|
|
|
|
|
|
|
|
|
davinci_dm365evm_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs dm365evm davinci davinci
|
|
|
|
|
|
|
|
|
|
davinci_dm6467evm_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs dm6467evm davinci davinci
|
|
|
|
|
|
|
|
|
|
imx27lite_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs imx27lite logicpd mx27
|
|
|
|
|
|
|
|
|
|
lpd7a400_config \
|
|
|
|
|
lpd7a404_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm lh7a40x lpd7a40x
|
|
|
|
|
|
|
|
|
|
mv88f6281gtw_ge_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs $(@:_config=) Marvell kirkwood
|
|
|
|
|
|
|
|
|
|
mx1ads_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t mx1ads NULL imx
|
|
|
|
|
|
|
|
|
|
mx1fs2_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t mx1fs2 NULL imx
|
|
|
|
|
|
|
|
|
|
netstar_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm925t netstar
|
|
|
|
|
|
|
|
|
|
nhk8815_config \
|
|
|
|
|
nhk8815_onenand_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@ > $(obj)include/config.h
|
|
|
|
|
@if [ "$(findstring _onenand, $@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_BOOT_ONENAND" >> $(obj)include/config.h; \
|
|
|
|
|
$(XECHO) "... configured to boot from OneNand Flash"; \
|
|
|
|
|
else \
|
|
|
|
|
$(XECHO) "... configured to boot from Nand Flash"; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a nhk8815 arm arm926ejs nhk8815 st nomadik
|
|
|
|
|
|
|
|
|
|
omap1510inn_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm925t omap1510inn ti
|
|
|
|
|
|
|
|
|
|
xtract_omap1610xxx = $(subst _cs0boot,,$(subst _cs3boot,,$(subst _cs_autoboot,,$(subst _config,,$1))))
|
|
|
|
|
|
|
|
|
|
omap1610inn_config \
|
|
|
|
|
omap1610inn_cs0boot_config \
|
|
|
|
|
omap1610inn_cs3boot_config \
|
|
|
|
|
omap1610inn_cs_autoboot_config \
|
|
|
|
|
omap1610h2_config \
|
|
|
|
|
omap1610h2_cs0boot_config \
|
|
|
|
|
omap1610h2_cs3boot_config \
|
|
|
|
|
omap1610h2_cs_autoboot_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _cs0boot_, $@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_CS0_BOOT" >> .$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... configured for CS0 boot"; \
|
|
|
|
|
elif [ "$(findstring _cs_autoboot_, $@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_CS_AUTOBOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... configured for CS_AUTO boot"; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_CS3_BOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... configured for CS3 boot"; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_omap1610xxx,$@) arm arm926ejs omap1610inn ti omap
|
|
|
|
|
|
|
|
|
|
omap5912osk_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs omap5912osk ti omap
|
|
|
|
|
|
|
|
|
|
openrd_base_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs $(@:_config=) Marvell kirkwood
|
|
|
|
|
|
|
|
|
|
xtract_omap730p2 = $(subst _cs0boot,,$(subst _cs3boot,, $(subst _config,,$1)))
|
|
|
|
|
|
|
|
|
|
omap730p2_config \
|
|
|
|
|
omap730p2_cs0boot_config \
|
|
|
|
|
omap730p2_cs3boot_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _cs0boot_, $@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_CS0_BOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... configured for CS0 boot"; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_CS3_BOOT" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... configured for CS3 boot"; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_omap730p2,$@) arm arm926ejs omap730p2 ti omap
|
|
|
|
|
|
|
|
|
|
rd6281a_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs $(@:_config=) Marvell kirkwood
|
|
|
|
|
|
|
|
|
|
sbc2410x_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t sbc2410x NULL s3c24x0
|
|
|
|
|
|
|
|
|
|
scb9328_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t scb9328 NULL imx
|
|
|
|
|
|
|
|
|
|
sheevaplug_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs $(@:_config=) Marvell kirkwood
|
|
|
|
|
|
|
|
|
|
smdk2400_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t smdk2400 samsung s3c24x0
|
|
|
|
|
|
|
|
|
|
smdk2410_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t smdk2410 samsung s3c24x0
|
|
|
|
|
|
|
|
|
|
spear300_config \
|
|
|
|
|
spear310_config \
|
|
|
|
|
spear320_config : unconfig
|
|
|
|
|
@$(MKCONFIG) -n $@ -t $(@:_config=) spear3xx arm arm926ejs $(@:_config=) spear spear
|
|
|
|
|
|
|
|
|
|
spear600_config : unconfig
|
|
|
|
|
@$(MKCONFIG) -n $@ -t $(@:_config=) spear6xx arm arm926ejs $(@:_config=) spear spear
|
|
|
|
|
|
|
|
|
|
suen3_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs km_arm keymile kirkwood
|
|
|
|
|
|
|
|
|
|
SX1_stdout_serial_config \
|
|
|
|
|
SX1_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _stdout_serial_, $@)" ] ; then \
|
|
|
|
|
echo "#undef CONFIG_STDOUT_USBTTY" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... configured for stdout serial"; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_STDOUT_USBTTY" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... configured for stdout usbtty"; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) SX1 arm arm925t sx1
|
|
|
|
|
|
|
|
|
|
# TRAB default configuration: 8 MB Flash, 32 MB RAM
|
|
|
|
|
xtract_trab = $(subst _bigram,,$(subst _bigflash,,$(subst _old,,$(subst _config,,$1))))
|
|
|
|
|
|
|
|
|
|
trab_config \
|
|
|
|
|
trab_bigram_config \
|
|
|
|
|
trab_bigflash_config \
|
|
|
|
|
trab_old_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/trab
|
|
|
|
|
@[ -z "$(findstring _bigram,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_FLASH_8MB" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_RAM_32MB" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 8 MB Flash, 32 MB RAM" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _bigflash,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_FLASH_16MB" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_RAM_16MB" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 16 MB Flash, 16 MB RAM" ; \
|
|
|
|
|
echo "TEXT_BASE = 0x0CF40000" >$(obj)board/trab/config.tmp ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _old,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_FLASH_8MB" >>$(obj)include/config.h ; \
|
|
|
|
|
echo "#define CONFIG_RAM_16MB" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 8 MB Flash, 16 MB RAM" ; \
|
|
|
|
|
echo "TEXT_BASE = 0x0CF40000" >$(obj)board/trab/config.tmp ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_trab,$@) arm arm920t trab NULL s3c24x0
|
|
|
|
|
|
|
|
|
|
tx25_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm926ejs tx25 karo mx25
|
|
|
|
|
@echo "CONFIG_NAND_U_BOOT = y" >> $(obj)include/config.mk
|
|
|
|
|
|
|
|
|
|
VCMA9_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t vcma9 mpl s3c24x0
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
# ARM supplied Versatile development boards
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
cm4008_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t cm4008 NULL ks8695
|
|
|
|
|
|
|
|
|
|
cm41xx_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm920t cm41xx NULL ks8695
|
|
|
|
|
|
|
|
|
|
versatile_config \
|
|
|
|
|
versatileab_config \
|
|
|
|
|
versatilepb_config : unconfig
|
|
|
|
|
@board/armltd/versatile/split_by_variant.sh $@
|
|
|
|
|
|
|
|
|
|
voiceblue_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm925t voiceblue
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## S3C44B0 Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
B2_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm s3c44b0 B2 dave
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## ARM720T Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
armadillo_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm720t armadillo
|
|
|
|
|
|
|
|
|
|
ep7312_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm720t ep7312
|
|
|
|
|
|
|
|
|
|
impa7_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm720t impa7
|
|
|
|
|
|
* Patch by Thomas Elste, 10 Feb 2004:
Add support for NET+50 CPU and ModNET50 board
* Patch by Sam Song, 10 Feb 2004:
Fix typos in cfi_flash.c
* Patch by Leon Kukovec, 10 Feb 2004
Fixed long dir entry slot id calculation in get_vfatname
* Patch by Robin Gilks, 10 Feb 2004:
add "itest" command (operators: -eq, -ne, -lt, -gt, -le, -ge, ==,
!=, <>, <, >, <=, >=)
21 years ago
|
|
|
modnet50_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm720t modnet50
|
* Patch by Thomas Elste, 10 Feb 2004:
Add support for NET+50 CPU and ModNET50 board
* Patch by Sam Song, 10 Feb 2004:
Fix typos in cfi_flash.c
* Patch by Leon Kukovec, 10 Feb 2004
Fixed long dir entry slot id calculation in get_vfatname
* Patch by Robin Gilks, 10 Feb 2004:
add "itest" command (operators: -eq, -ne, -lt, -gt, -le, -ge, ==,
!=, <>, <, >, <=, >=)
21 years ago
|
|
|
|
|
|
|
|
evb4510_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm720t evb4510 NULL s3c4510b
|
|
|
|
|
|
|
|
|
|
lpc2292sodimm_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm720t lpc2292sodimm NULL lpc2292
|
|
|
|
|
|
|
|
|
|
SMN42_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm720t SMN42 siemens lpc2292
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## ARM CORTEX Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
devkit8000_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 devkit8000 timll omap3
|
|
|
|
|
|
|
|
|
|
omap3_beagle_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 beagle ti omap3
|
|
|
|
|
|
|
|
|
|
omap3_overo_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 overo NULL omap3
|
|
|
|
|
|
|
|
|
|
omap3_evm_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 evm ti omap3
|
|
|
|
|
|
|
|
|
|
omap3_pandora_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 pandora NULL omap3
|
|
|
|
|
|
|
|
|
|
omap3_sdp3430_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 sdp3430 ti omap3
|
|
|
|
|
|
|
|
|
|
omap3_zoom1_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 zoom1 logicpd omap3
|
|
|
|
|
|
|
|
|
|
omap3_zoom2_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 zoom2 logicpd omap3
|
|
|
|
|
|
|
|
|
|
smdkc100_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 smdkc100 samsung s5pc1xx
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## XScale Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
actux1_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm ixp actux1
|
|
|
|
|
|
|
|
|
|
actux2_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm ixp actux2
|
|
|
|
|
|
|
|
|
|
actux3_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm ixp actux3
|
|
|
|
|
|
|
|
|
|
actux4_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm ixp actux4
|
|
|
|
|
|
|
|
|
|
cerf250_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa cerf250
|
|
|
|
|
|
|
|
|
|
cradle_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa cradle
|
|
|
|
|
|
|
|
|
|
csb226_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa csb226
|
|
|
|
|
|
|
|
|
|
delta_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa delta
|
|
|
|
|
|
|
|
|
|
innokom_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa innokom
|
|
|
|
|
|
|
|
|
|
ixdp425_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm ixp ixdp425
|
|
|
|
|
|
|
|
|
|
ixdpg425_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm ixp ixdp425
|
|
|
|
|
|
|
|
|
|
lubbock_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa lubbock
|
|
|
|
|
|
|
|
|
|
pleb2_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa pleb2
|
|
|
|
|
|
|
|
|
|
logodl_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa logodl
|
|
|
|
|
|
|
|
|
|
pdnb3_config \
|
|
|
|
|
scpu_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring scpu_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SCPU" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... on SCPU board variant" ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a pdnb3 arm ixp pdnb3 prodrive
|
|
|
|
|
|
|
|
|
|
pxa255_idp_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa pxa255_idp
|
|
|
|
|
|
|
|
|
|
polaris_config \
|
|
|
|
|
trizepsiv_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring polaris,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_POLARIS 1" >>$(obj)include/config.h ; \
|
|
|
|
|
fi;
|
|
|
|
|
@$(MKCONFIG) -a trizepsiv arm pxa trizepsiv
|
|
|
|
|
|
|
|
|
|
wepep250_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa wepep250
|
|
|
|
|
|
|
|
|
|
xaeniax_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa xaeniax
|
|
|
|
|
|
|
|
|
|
xm250_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa xm250
|
|
|
|
|
|
|
|
|
|
xsengine_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa xsengine
|
|
|
|
|
|
|
|
|
|
zylonite_config :
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm pxa zylonite
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## ARM1136 Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
apollon_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_ONENAND_U_BOOT" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm1136 apollon NULL omap24xx
|
|
|
|
|
@echo "CONFIG_ONENAND_U_BOOT = y" >> $(obj)include/config.mk
|
|
|
|
|
|
|
|
|
|
imx31_litekit_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm1136 imx31_litekit logicpd mx31
|
|
|
|
|
|
|
|
|
|
imx31_phycore_eet_config \
|
|
|
|
|
imx31_phycore_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ -n "$(findstring _eet_,$@)" ]; then \
|
|
|
|
|
echo "#define CONFIG_IMX31_PHYCORE_EET" >> $(obj)include/config.h; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a imx31_phycore arm arm1136 imx31_phycore NULL mx31
|
|
|
|
|
|
|
|
|
|
mx31ads_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm1136 mx31ads freescale mx31
|
|
|
|
|
|
|
|
|
|
mx31pdk_config \
|
|
|
|
|
mx31pdk_nand_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ -n "$(findstring _nand_,$@)" ]; then \
|
|
|
|
|
echo "#define CONFIG_NAND_U_BOOT" >> $(obj)include/config.h; \
|
|
|
|
|
else \
|
|
|
|
|
echo "#define CONFIG_SKIP_LOWLEVEL_INIT" >> $(obj)include/config.h; \
|
|
|
|
|
echo "#define CONFIG_SKIP_RELOCATE_UBOOT" >> $(obj)include/config.h; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a mx31pdk arm arm1136 mx31pdk freescale mx31
|
|
|
|
|
|
|
|
|
|
mx51evk_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm_cortexa8 mx51evk freescale mx51
|
|
|
|
|
|
|
|
|
|
omap2420h4_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm1136 omap2420h4 ti omap24xx
|
|
|
|
|
|
|
|
|
|
qong_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) arm arm1136 qong davedenx mx31
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## ARM1176 Systems
|
|
|
|
|
#########################################################################
|
|
|
|
|
smdk6400_noUSB_config \
|
|
|
|
|
smdk6400_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include $(obj)board/samsung/smdk6400
|
|
|
|
|
@mkdir -p $(obj)nand_spl/board/samsung/smdk6400
|
|
|
|
|
@echo "#define CONFIG_NAND_U_BOOT" > $(obj)include/config.h
|
|
|
|
|
@if [ -z "$(findstring smdk6400_noUSB_config,$@)" ]; then \
|
|
|
|
|
echo "RAM_TEXT = 0x57e00000" >> $(obj)board/samsung/smdk6400/config.tmp;\
|
|
|
|
|
$(MKCONFIG) $(@:_config=) arm arm1176 smdk6400 samsung s3c64xx; \
|
|
|
|
|
else \
|
|
|
|
|
echo "RAM_TEXT = 0xc7e00000" >> $(obj)board/samsung/smdk6400/config.tmp;\
|
|
|
|
|
$(MKCONFIG) $(@:_noUSB_config=) arm arm1176 smdk6400 samsung s3c64xx; \
|
|
|
|
|
fi
|
|
|
|
|
@echo "CONFIG_NAND_U_BOOT = y" >> $(obj)include/config.mk
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
# i386
|
|
|
|
|
#========================================================================
|
|
|
|
|
#########################################################################
|
|
|
|
|
## AMD SC520 CDP
|
|
|
|
|
#########################################################################
|
|
|
|
|
eNET_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) i386 i386 eNET NULL sc520
|
|
|
|
|
|
|
|
|
|
sc520_cdp_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) i386 i386 sc520_cdp NULL sc520
|
|
|
|
|
|
|
|
|
|
sc520_spunk_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) i386 i386 sc520_spunk NULL sc520
|
|
|
|
|
|
|
|
|
|
sc520_spunk_rel_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) i386 i386 sc520_spunk NULL sc520
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
# MIPS
|
|
|
|
|
#========================================================================
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MIPS32 4Kc
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
xtract_incaip = $(subst _100MHz,,$(subst _133MHz,,$(subst _150MHz,,$(subst _config,,$1))))
|
|
|
|
|
|
|
|
|
|
incaip_100MHz_config \
|
|
|
|
|
incaip_133MHz_config \
|
|
|
|
|
incaip_150MHz_config \
|
|
|
|
|
incaip_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring _100MHz,$@)" ] || \
|
|
|
|
|
{ echo "#define CPU_CLOCK_RATE 100000000" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 100MHz system clock" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _133MHz,$@)" ] || \
|
|
|
|
|
{ echo "#define CPU_CLOCK_RATE 133000000" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 133MHz system clock" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _150MHz,$@)" ] || \
|
|
|
|
|
{ echo "#define CPU_CLOCK_RATE 150000000" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... with 150MHz system clock" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_incaip,$@) mips mips incaip
|
|
|
|
|
|
|
|
|
|
tb0229_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) mips mips tb0229
|
|
|
|
|
|
|
|
|
|
vct_premium_config \
|
|
|
|
|
vct_premium_small_config \
|
|
|
|
|
vct_premium_onenand_config \
|
|
|
|
|
vct_premium_onenand_small_config \
|
|
|
|
|
vct_platinum_config \
|
|
|
|
|
vct_platinum_small_config \
|
|
|
|
|
vct_platinum_onenand_config \
|
|
|
|
|
vct_platinum_onenand_small_config \
|
|
|
|
|
vct_platinumavc_config \
|
|
|
|
|
vct_platinumavc_small_config \
|
|
|
|
|
vct_platinumavc_onenand_config \
|
|
|
|
|
vct_platinumavc_onenand_small_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@if [ "$(findstring _premium,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_VCT_PREMIUM" > $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... on Premium board variant" ; \
|
|
|
|
|
fi
|
|
|
|
|
@if [ "$(findstring _platinum_,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_VCT_PLATINUM" > $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... on Platinum board variant" ; \
|
|
|
|
|
fi
|
|
|
|
|
@if [ "$(findstring _platinumavc,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_VCT_PLATINUMAVC" > $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... on PlatinumAVC board variant" ; \
|
|
|
|
|
fi
|
|
|
|
|
@if [ "$(findstring _onenand,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_VCT_ONENAND" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... on OneNAND board variant" ; \
|
|
|
|
|
fi
|
|
|
|
|
@if [ "$(findstring _small,$@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_VCT_SMALL_IMAGE" >> $(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... stripped down image variant" ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a vct mips mips vct micronas
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MIPS32 AU1X00
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
dbau1000_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_DBAU1000 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a dbau1x00 mips mips dbau1x00
|
|
|
|
|
|
|
|
|
|
dbau1100_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_DBAU1100 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a dbau1x00 mips mips dbau1x00
|
|
|
|
|
|
|
|
|
|
dbau1500_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_DBAU1500 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a dbau1x00 mips mips dbau1x00
|
|
|
|
|
|
|
|
|
|
dbau1550_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_DBAU1550 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a dbau1x00 mips mips dbau1x00
|
|
|
|
|
|
|
|
|
|
dbau1550_el_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_DBAU1550 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a dbau1x00 mips mips dbau1x00
|
|
|
|
|
|
|
|
|
|
gth2_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_GTH2 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a gth2 mips mips gth2
|
|
|
|
|
|
|
|
|
|
pb1000_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_PB1000 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a pb1x00 mips mips pb1x00
|
|
|
|
|
|
|
|
|
|
qemu_mips_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_QEMU_MIPS 1" >$(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a qemu-mips mips mips qemu-mips
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## MIPS64 5Kc
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
purple_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) mips mips purple
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
# Nios
|
|
|
|
|
#========================================================================
|
|
|
|
|
#########################################################################
|
|
|
|
|
## Nios32
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
ADNPESC1_DNPEVA2_base_32_config \
|
|
|
|
|
ADNPESC1_base_32_config \
|
|
|
|
|
ADNPESC1_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring _DNPEVA2,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_DNPEVA2 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... DNP/EVA2 configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _base_32,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NIOS_BASE_32 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... NIOS 'base_32' configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring ADNPESC1_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NIOS_BASE_32 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... NIOS 'base_32' configuration (DEFAULT)" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a ADNPESC1 nios nios adnpesc1 ssv
|
|
|
|
|
|
|
|
|
|
DK1C20_safe_32_config \
|
|
|
|
|
DK1C20_standard_32_config \
|
|
|
|
|
DK1C20_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring _safe_32,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NIOS_SAFE_32 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... NIOS 'safe_32' configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _standard_32,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NIOS_STANDARD_32 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... NIOS 'standard_32' configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring DK1C20_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NIOS_STANDARD_32 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... NIOS 'standard_32' configuration (DEFAULT)" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a DK1C20 nios nios dk1c20 altera
|
|
|
|
|
|
|
|
|
|
DK1S10_safe_32_config \
|
|
|
|
|
DK1S10_standard_32_config \
|
|
|
|
|
DK1S10_mtx_ldk_20_config \
|
|
|
|
|
DK1S10_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@[ -z "$(findstring _safe_32,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NIOS_SAFE_32 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... NIOS 'safe_32' configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _standard_32,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NIOS_STANDARD_32 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... NIOS 'standard_32' configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring _mtx_ldk_20,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NIOS_MTX_LDK_20 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... NIOS 'mtx_ldk_20' configuration" ; \
|
|
|
|
|
}
|
|
|
|
|
@[ -z "$(findstring DK1S10_config,$@)" ] || \
|
|
|
|
|
{ echo "#define CONFIG_NIOS_STANDARD_32 1" >>$(obj)include/config.h ; \
|
|
|
|
|
$(XECHO) "... NIOS 'standard_32' configuration (DEFAULT)" ; \
|
|
|
|
|
}
|
|
|
|
|
@$(MKCONFIG) -a DK1S10 nios nios dk1s10 altera
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## Nios-II
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
EP1C20_config : unconfig
|
|
|
|
|
@$(MKCONFIG) EP1C20 nios2 nios2 ep1c20 altera
|
|
|
|
|
|
|
|
|
|
EP1S10_config : unconfig
|
|
|
|
|
@$(MKCONFIG) EP1S10 nios2 nios2 ep1s10 altera
|
|
|
|
|
|
|
|
|
|
EP1S40_config : unconfig
|
|
|
|
|
@$(MKCONFIG) EP1S40 nios2 nios2 ep1s40 altera
|
|
|
|
|
|
|
|
|
|
PK1C20_config : unconfig
|
|
|
|
|
@$(MKCONFIG) PK1C20 nios2 nios2 pk1c20 psyent
|
|
|
|
|
|
|
|
|
|
PCI5441_config : unconfig
|
|
|
|
|
@$(MKCONFIG) PCI5441 nios2 nios2 pci5441 psyent
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
## Microblaze
|
|
|
|
|
#========================================================================
|
|
|
|
|
|
|
|
|
|
microblaze-generic_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) microblaze microblaze microblaze-generic xilinx
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
# Blackfin
|
|
|
|
|
#========================================================================
|
|
|
|
|
|
|
|
|
|
# Analog Devices boards
|
|
|
|
|
BFIN_BOARDS = bf518f-ezbrd bf526-ezbrd bf527-ezkit bf533-ezkit bf533-stamp \
|
|
|
|
|
bf537-pnav bf537-stamp bf538f-ezkit bf548-ezkit bf561-ezkit
|
|
|
|
|
|
|
|
|
|
# Bluetechnix tinyboards
|
|
|
|
|
BFIN_BOARDS += cm-bf527 cm-bf533 cm-bf537e cm-bf537u cm-bf548 cm-bf561 \
|
|
|
|
|
tcm-bf518 tcm-bf537
|
|
|
|
|
|
|
|
|
|
# Misc third party boards
|
|
|
|
|
BFIN_BOARDS += bf537-minotaur bf537-srv1 bf561-acvilon blackstamp
|
|
|
|
|
|
|
|
|
|
# I-SYST Micromodule
|
|
|
|
|
BFIN_BOARDS += ibf-dsp561
|
|
|
|
|
|
|
|
|
|
$(BFIN_BOARDS:%=%_config) : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) blackfin blackfin $(@:_config=)
|
|
|
|
|
|
|
|
|
|
bf527-ezkit-v2_config : unconfig
|
|
|
|
|
@$(MKCONFIG) -t BF527_EZKIT_REV_2_1 \
|
|
|
|
|
bf527-ezkit blackfin blackfin bf527-ezkit
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
# AVR32
|
|
|
|
|
#========================================================================
|
|
|
|
|
|
|
|
|
|
atngw100_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) avr32 at32ap atngw100 atmel at32ap700x
|
|
|
|
|
|
|
|
|
|
atstk1002_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) avr32 at32ap atstk1000 atmel at32ap700x
|
|
|
|
|
|
|
|
|
|
atstk1003_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) avr32 at32ap atstk1000 atmel at32ap700x
|
|
|
|
|
|
|
|
|
|
atstk1004_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) avr32 at32ap atstk1000 atmel at32ap700x
|
|
|
|
|
|
|
|
|
|
atstk1006_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) avr32 at32ap atstk1000 atmel at32ap700x
|
|
|
|
|
|
avr32: add support for EarthLCD Favr-32 board
This patch adds support for the Favr-32 board made by EarthLCD.
This kit, which is also called ezLCD-101 when running with EarthLCD firmware,
has a 10.4" touch screen LCD panel, 16 MB 32-bit SDRAM, 8 MB parallel flash,
Ethernet, audio out, USB device, SD-card slot, USART and various other
connectors for cennecting stuff to SPI, I2C, GPIO, etc.
Signed-off-by: Hans-Christian Egtvedt <hans-christian.egtvedt@atmel.com>
Signed-off-by: Haavard Skinnemoen <haavard.skinnemoen@atmel.com>
17 years ago
|
|
|
favr-32-ezkit_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) avr32 at32ap favr-32-ezkit earthlcd at32ap700x
|
|
|
|
|
|
|
|
|
|
hammerhead_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) avr32 at32ap hammerhead miromico at32ap700x
|
|
|
|
|
|
|
|
|
|
mimc200_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) avr32 at32ap mimc200 mimc at32ap700x
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
# SH3 (SuperH)
|
|
|
|
|
#========================================================================
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## sh2 (Renesas SuperH)
|
|
|
|
|
#########################################################################
|
|
|
|
|
rsk7203_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_RSK7203 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh2 rsk7203 renesas
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## sh3 (Renesas SuperH)
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
mpr2_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_MPR2 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh3 mpr2
|
|
|
|
|
|
|
|
|
|
ms7720se_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_MS7720SE 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh3 ms7720se
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## sh4 (Renesas SuperH)
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
MigoR_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_MIGO_R 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh4 MigoR renesas
|
|
|
|
|
|
|
|
|
|
ms7750se_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_MS7750SE 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh4 ms7750se
|
|
|
|
|
|
|
|
|
|
ms7722se_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_MS7722SE 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh4 ms7722se
|
|
|
|
|
|
|
|
|
|
r2dplus_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_R2DPLUS 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh4 r2dplus renesas
|
|
|
|
|
|
|
|
|
|
r7780mp_config: unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_R7780MP 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh4 r7780mp renesas
|
|
|
|
|
|
|
|
|
|
sh7763rdp_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_SH7763RDP 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh4 sh7763rdp renesas
|
|
|
|
|
|
|
|
|
|
xtract_sh7785lcr = $(subst _32bit,,$(subst _config,,$1))
|
|
|
|
|
sh7785lcr_32bit_config \
|
|
|
|
|
sh7785lcr_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@mkdir -p $(obj)board/renesas/sh7785lcr
|
|
|
|
|
@echo "#define CONFIG_SH7785LCR 1" > $(obj)include/config.h
|
|
|
|
|
@if [ "$(findstring 32bit, $@)" ] ; then \
|
|
|
|
|
echo "#define CONFIG_SH_32BIT 1" >> $(obj)include/config.h ; \
|
|
|
|
|
echo "TEXT_BASE = 0x8ff80000" > \
|
|
|
|
|
$(obj)board/renesas/sh7785lcr/config.tmp ; \
|
|
|
|
|
$(XECHO) " ... enable 32-Bit Address Extended Mode" ; \
|
|
|
|
|
fi
|
|
|
|
|
@$(MKCONFIG) -a $(call xtract_sh7785lcr,$@) sh sh4 sh7785lcr renesas
|
|
|
|
|
|
|
|
|
|
ap325rxa_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_AP325RXA 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh4 ap325rxa renesas
|
|
|
|
|
|
|
|
|
|
espt_config : unconfig
|
|
|
|
|
@mkdir -p $(obj)include
|
|
|
|
|
@echo "#define CONFIG_ESPT 1" > $(obj)include/config.h
|
|
|
|
|
@$(MKCONFIG) -a $(@:_config=) sh sh4 espt
|
|
|
|
|
|
|
|
|
|
#========================================================================
|
|
|
|
|
# SPARC
|
|
|
|
|
#========================================================================
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## LEON3
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
# Gaisler GR-XC3S-1500 board
|
|
|
|
|
gr_xc3s_1500_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) sparc leon3 gr_xc3s_1500 gaisler
|
|
|
|
|
|
|
|
|
|
# Gaisler GR-CPCI-AX2000 board, a General purpose FPGA-AX system
|
|
|
|
|
gr_cpci_ax2000_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) sparc leon3 gr_cpci_ax2000 gaisler
|
|
|
|
|
|
|
|
|
|
# Gaisler GRLIB template design (GPL SPARC/LEON3) for Altera NIOS
|
|
|
|
|
# Development board Stratix II edition, FPGA Device EP2S60.
|
|
|
|
|
gr_ep2s60_config: unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) sparc leon3 gr_ep2s60 gaisler
|
|
|
|
|
|
|
|
|
|
# Gaisler LEON3 GRSIM simulator
|
|
|
|
|
grsim_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) sparc leon3 grsim gaisler
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
## LEON2
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
# Gaisler LEON2 GRSIM simulator
|
|
|
|
|
grsim_leon2_config : unconfig
|
|
|
|
|
@$(MKCONFIG) $(@:_config=) sparc leon2 grsim_leon2 gaisler
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
|
|
|
|
#########################################################################
|
|
|
|
|
#########################################################################
|
|
|
|
|
|
|
|
|
|
clean:
|
|
|
|
|
@rm -f $(obj)examples/standalone/82559_eeprom \
|
|
|
|
|
$(obj)examples/standalone/atmel_df_pow2 \
|
|
|
|
|
$(obj)examples/standalone/eepro100_eeprom \
|
|
|
|
|
$(obj)examples/standalone/hello_world \
|
|
|
|
|
$(obj)examples/standalone/interrupt \
|
|
|
|
|
$(obj)examples/standalone/mem_to_mem_idma2intr \
|
|
|
|
|
$(obj)examples/standalone/sched \
|
|
|
|
|
$(obj)examples/standalone/smc91111_eeprom \
|
|
|
|
|
$(obj)examples/standalone/test_burst \
|
|
|
|
|
$(obj)examples/standalone/timer
|
|
|
|
|
@rm -f $(obj)examples/api/demo{,.bin}
|
|
|
|
|
@rm -f $(obj)tools/bmp_logo $(obj)tools/easylogo/easylogo \
|
|
|
|
|
$(obj)tools/env/{fw_printenv,fw_setenv} \
|
|
|
|
|
$(obj)tools/envcrc \
|
|
|
|
|
$(obj)tools/gdb/{astest,gdbcont,gdbsend} \
|
|
|
|
|
$(obj)tools/gen_eth_addr $(obj)tools/img2srec \
|
|
|
|
|
$(obj)tools/mkimage $(obj)tools/mpc86x_clk \
|
|
|
|
|
$(obj)tools/ncb $(obj)tools/ubsha1
|
|
|
|
|
@rm -f $(obj)board/cray/L1/{bootscript.c,bootscript.image} \
|
|
|
|
|
$(obj)board/netstar/{eeprom,crcek,crcit,*.srec,*.bin} \
|
|
|
|
|
$(obj)board/trab/trab_fkt $(obj)board/voiceblue/eeprom \
|
|
|
|
|
$(obj)board/armltd/{integratorap,integratorcp}/u-boot.lds \
|
|
|
|
|
$(obj)lib_blackfin/u-boot.lds \
|
|
|
|
|
$(obj)u-boot.lds \
|
|
|
|
|
$(obj)cpu/blackfin/bootrom-asm-offsets.[chs]
|
|
|
|
|
@rm -f $(obj)include/bmp_logo.h
|
|
|
|
|
@rm -f $(obj)nand_spl/{u-boot.lds,u-boot-spl,u-boot-spl.map,System.map}
|
|
|
|
|
@rm -f $(obj)onenand_ipl/onenand-{ipl,ipl.bin,ipl.map}
|
|
|
|
|
@rm -f $(ONENAND_BIN)
|
|
|
|
|
@rm -f $(obj)onenand_ipl/u-boot.lds
|
|
|
|
|
@rm -f $(TIMESTAMP_FILE) $(VERSION_FILE)
|
|
|
|
|
@find $(OBJTREE) -type f \
|
|
|
|
|
\( -name 'core' -o -name '*.bak' -o -name '*~' \
|
|
|
|
|
-o -name '*.o' -o -name '*.a' -o -name '*.exe' \) -print \
|
|
|
|
|
| xargs rm -f
|
|
|
|
|
|
|
|
|
|
clobber: clean
|
|
|
|
|
@find $(OBJTREE) -type f \( -name .depend \
|
|
|
|
|
-o -name '*.srec' -o -name '*.bin' -o -name u-boot.img \) \
|
|
|
|
|
-print0 \
|
|
|
|
|
| xargs -0 rm -f
|
|
|
|
|
@rm -f $(OBJS) $(obj)*.bak $(obj)ctags $(obj)etags $(obj)TAGS \
|
|
|
|
|
$(obj)cscope.* $(obj)*.*~
|
|
|
|
|
@rm -f $(obj)u-boot $(obj)u-boot.map $(obj)u-boot.hex $(ALL)
|
|
|
|
|
@rm -f $(obj)u-boot.kwb
|
|
|
|
|
@rm -f $(obj)u-boot.imx
|
|
|
|
|
@rm -f $(obj)tools/{env/crc32.c,inca-swap-bytes}
|
|
|
|
|
@rm -f $(obj)cpu/mpc824x/bedbug_603e.c
|
|
|
|
|
@rm -f $(obj)include/asm/proc $(obj)include/asm/arch $(obj)include/asm
|
|
|
|
|
@[ ! -d $(obj)nand_spl ] || find $(obj)nand_spl -name "*" -type l -print | xargs rm -f
|
|
|
|
|
@[ ! -d $(obj)onenand_ipl ] || find $(obj)onenand_ipl -name "*" -type l -print | xargs rm -f
|
|
|
|
|
|
|
|
|
|
ifeq ($(OBJTREE),$(SRCTREE))
|
|
|
|
|
mrproper \
|
|
|
|
|
distclean: clobber unconfig
|
|
|
|
|
else
|
|
|
|
|
mrproper \
|
|
|
|
|
distclean: clobber unconfig
|
|
|
|
|
rm -rf $(obj)*
|
|
|
|
|
endif
|
|
|
|
|
|
|
|
|
|
backup:
|
|
|
|
|
F=`basename $(TOPDIR)` ; cd .. ; \
|
|
|
|
|
gtar --force-local -zcvf `date "+$$F-%Y-%m-%d-%T.tar.gz"` $$F
|
|
|
|
|
|
|
|
|
|
#########################################################################
|
